CAS 2516-97-4
:(Methylsulfonyl)acetic acid
Description:
(Methylsulfonyl)acetic acid, with the CAS number 2516-97-4, is an organic compound characterized by the presence of both a methylsulfonyl group and a carboxylic acid functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in water and various organic solvents, which enhances its utility in chemical synthesis and applications. The presence of the methylsulfonyl group imparts unique properties, such as potential biological activity and the ability to act as a sulfonylating agent. (Methylsulfonyl)acetic acid can participate in various chemical reactions, including esterification and amidation, making it valuable in pharmaceutical and agrochemical research. Additionally, it may exhibit mild acidity due to the carboxylic acid group, which can influence its reactivity and interactions with other chemical species. Overall, this compound is of interest in both industrial and research settings due to its versatile chemical behavior and potential applications.
Formula:C3H6O4S
InChI:InChI=1S/C3H6O4S/c1-8(6,7)2-3(4)5/h2H2,1H3,(H,4,5)
InChI key:InChIKey=NYEHUAQIJXERLP-UHFFFAOYSA-N
SMILES:C(S(C)(=O)=O)C(O)=O
Synonyms:- (Methylsulfonyl)Acetic Acid
- 2-(Methylsulfonyl)acetic acid
- 2-Methanesulfonylacetic acid
- Acetic acid, (methylsulfonyl)-
- Acetic acid, 2-(methylsulfonyl)-
- Mesylacetic acid
- Methanesulfonylacetic acid
- Methylsulphonylacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Acetic acid, 2-(methylsulfonyl)-
CAS:Formula:C3H6O4SPurity:96%Color and Shape:SolidMolecular weight:138.1423Ref: IN-DA002QP1
1g28.00€5g31.00€10g53.00€25g74.00€5kgTo inquire100g127.00€10kgTo inquire250g228.00€500g583.00€250mg25.00€(Methylsulfonyl)acetic Acid
CAS:Formula:C3H6O4SPurity:>98.0%(T)Color and Shape:White to Orange to Green powder to crystalineMolecular weight:138.14(Methylsulphonyl)acetic acid
CAS:<p>(Methylsulphonyl)acetic acid</p>Formula:C3H6O4SPurity:98%Color and Shape: white crystalline solidMolecular weight:138.14g/molMethanesulphonyl acetic acid
CAS:<p>Methanesulphonyl acetic acid is a synthetic compound that is structurally related to the neurotransmitter serotonin. It was developed as an antibacterial agent in the late 1950s and early 1960s, but was never marketed because of its adverse effects on 5-hydroxytryptamine (5-HT) receptors, which are involved in depression and psychotic disorders. Methanesulphonyl acetic acid has been shown to inhibit receptor activity for 5-HT2A receptors, which may be due to its structural similarity with serotonin. This drug also has a molecular descriptor of constant logP value (-0.44), acidic pKa (-1.38), and molecular weight (204).</p>Formula:C3H6O4SPurity:Min. 95%Color and Shape:PowderMolecular weight:138.14 g/molMethanesulfonylacetic Acid
CAS:Controlled Product<p>Applications Methanesulfonylacetic acid (cas# 2516-97-4) is a useful research chemical.<br></p>Formula:C3H6O4SColor and Shape:NeatMolecular weight:138.14






