CAS 251645-83-7: (1S,E)-(-)-Camphorquinone 3-oxime
Description:(1S,E)-(-)-Camphorquinone 3-oxime, with the CAS number 251645-83-7, is an organic compound characterized by its unique structural features derived from camphor. It is an oxime derivative, which means it contains a hydroxylamine functional group (-C=N-OH) attached to a carbonyl carbon. This compound exhibits a chiral center, contributing to its stereochemistry, specifically the (1S) configuration, which influences its biological activity and interactions. Camphorquinone derivatives are known for their applications in organic synthesis and as intermediates in the production of various pharmaceuticals. The compound typically appears as a solid at room temperature and is soluble in organic solvents. Its reactivity is influenced by the presence of the oxime functional group, which can participate in various chemical reactions, including condensation and rearrangement. Additionally, (1S,E)-(-)-Camphorquinone 3-oxime may exhibit specific optical activity due to its chiral nature, making it of interest in studies related to stereochemistry and asymmetric synthesis.
Formula:C10H15NO2
InChI:InChI=1/C10H15NO2/c1-11-7-3-5-8(10(12)13-2)9(11)6-4-7/h5,7,9H,3-4,6H2,1-2H3
- Synonyms:
- 2-Carbomethoxy-8-methyl-8-azabicyclo[3.2.1]oct-2-ene
- 8-Azabicyclo[3.2.1]Oct-2-Ene-2-Carboxylic Acid, 8-Methyl-, Methyl Ester
- Methyl 8-Methyl-8-Azabicyclo[3.2.1]Oct-2-Ene-2-Carboxylate
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Bicyclo[2.2.1]heptane-2,3-dione, 1,7,7-trimethyl-, 3-oxime, (1S,4R)- REF: IN-DA002QPPCAS: 251645-83-7 | - - - | To inquire | Wed 26 Mar 25 |
 | (1S,E)-(-)-Camphorquinone 3-oxime REF: 54-OR907065CAS: 251645-83-7 | 95% | 400.00 € | Wed 02 Apr 25 |
 | (1S,4R,E)-3-(hydroxyimino)-1,7,7-trimethylbicyclo[2.2.1]Heptan-2-one REF: 10-F772279CAS: 251645-83-7 | 98% | - - - | Discontinued product |
 | (1S,e)-(-)-Camphorquinone3-oxime REF: 3D-FC149232CAS: 251645-83-7 | Min. 95% | - - - | Discontinued product |
![Bicyclo[2.2.1]heptane-2,3-dione, 1,7,7-trimethyl-, 3-oxime, (1S,4R)-](https://static.cymitquimica.com/products/IN/thumb/DA002QPP.jpg)
Bicyclo[2.2.1]heptane-2,3-dione, 1,7,7-trimethyl-, 3-oxime, (1S,4R)-
Ref: IN-DA002QPP
| Undefined size | To inquire |
Ref: 54-OR907065
| 1g | 400.00 € |
![(1S,4R,E)-3-(hydroxyimino)-1,7,7-trimethylbicyclo[2.2.1]Heptan-2-one](https://static.cymitquimica.com/products/10/thumb/F772279.jpg)
(1S,4R,E)-3-(hydroxyimino)-1,7,7-trimethylbicyclo[2.2.1]Heptan-2-one
Ref: 10-F772279
| 1g | Discontinued | Request information |
(1S,e)-(-)-Camphorquinone3-oxime
Ref: 3D-FC149232
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
