CymitQuimica logo

CAS 251647-53-7

:

Adenosine,N-benzoyl-5'-O-[bis(4-methoxyphenyl)phenylmethyl]-2'-O-(2-methoxyethyl)-, 3'-[2-cyanoethyl bis(1-methylethyl)phosphoramidite]

Description:
Adenosine, N-benzoyl-5'-O-[bis(4-methoxyphenyl)phenylmethyl]-2'-O-(2-methoxyethyl)-, 3'-[2-cyanoethyl bis(1-methylethyl)phosphoramidite] is a complex chemical compound primarily used in the field of nucleic acid chemistry, particularly in the synthesis of oligonucleotides. This compound features a modified adenosine structure, which includes various functional groups such as benzoyl and methoxyphenyl moieties, enhancing its reactivity and solubility. The presence of phosphoramidite functionality allows for its use in automated DNA synthesis, facilitating the incorporation of modified nucleotides into oligonucleotide sequences. The compound's unique structure contributes to its stability and efficiency in biochemical applications, making it valuable for research in molecular biology, genetic engineering, and therapeutic development. Its CAS number, 251647-53-7, serves as a unique identifier for regulatory and commercial purposes, ensuring precise communication regarding this specific chemical entity. Overall, this compound exemplifies the intricate design often employed in the development of nucleic acid analogs for advanced scientific applications.
Formula:C50H58N7O9P
InChI:InChI=1S/C50H58N7O9P/c1-34(2)57(35(3)4)67(64-28-14-27-51)66-44-42(31-63-50(37-17-12-9-13-18-37,38-19-23-40(60-6)24-20-38)39-21-25-41(61-7)26-22-39)65-49(45(44)62-30-29-59-5)56-33-54-43-46(52-32-53-47(43)56)55-48(58)36-15-10-8-11-16-36/h8-13,15-26,32-35,42,44-45,49H,14,28-31H2,1-7H3,(H,52,53,55,58)/t42-,44-,45-,49-,67?/m1/s1
InChI key:VPBYBQBHLYRLHG-HDMAWCRFSA-N
SMILES:CC(C)N(C(C)C)P(OCCC#N)O[C@@H]1[C@H](O[C@H]([C@@H]1OCCOC)N2C=NC3=C(N=CN=C32)NC(=O)C4=CC=CC=C4)COC(C5=CC=CC=C5)(C6=CC=C(C=C6)OC)C7=CC=C(C=C7)OC
Synonyms:
  • DMT-2'-O-MOE-A(Bz)-CE Phosphoramidite
Found 10 products.