CAS 25167-62-8
:Docosahexaenoic acid
Description:
Docosahexaenoic acid (DHA) is a long-chain omega-3 fatty acid characterized by its 22 carbon atoms and six double bonds, making it highly unsaturated. It is primarily found in marine sources, particularly in fish oils, and is crucial for human health, especially for brain and eye development. DHA plays a significant role in cellular membrane fluidity and function, influencing various physiological processes. It is known for its anti-inflammatory properties and potential benefits in cardiovascular health, cognitive function, and neurodevelopment. The chemical structure of DHA includes a carboxylic acid group at one end, contributing to its classification as a fatty acid. Its molecular formula is C22H32O2, and it is typically represented in its cis configuration, which is essential for its biological activity. DHA is often consumed through dietary sources or supplements, and its deficiency can lead to various health issues, particularly in infants and pregnant women. Overall, DHA is a vital nutrient with significant implications for health and wellness.
Formula:C22H32O2
InChI:InChI=1/C22H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h3-4,6-7,9-10,12-13,15-16,18-19H,2,5,8,11,14,17,20-21H2,1H3,(H,23,24)/b4-3+,7-6+,10-9+,13-12+,16-15+,19-18-
Synonyms:- Docosahexaenoicacid,97
- cis-4,7,13,16,19-Docosahexaenoic acid (stabilized with vitamine E)
- Docosahexaenoic acid
- Doconexent
- Docosa Hexaenoic Acid
- (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoic acid
- (4E,7E,10Z,13E,16E,19E)-docosa-4,7,10,13,16,19-hexaenoic acid
- (4Z,7E,10E,13E,16E,19E)-docosa-4,7,10,13,16,19-hexaenoic acid
- DHA
- 4,7,10,13,16,19-Docosahexaenoic Acid
- DHE
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Docosa-2,4,6,8,10,12-hexaenoic acid
CAS:Formula:C22H32O2Purity:95.0%Color and Shape:SolidMolecular weight:328.496Docosahexaenoic acid
CAS:Docosahexaenoic acid (DHA) is a fatty acid that is usually obtained from fish oil. DHA has been shown to decrease the production of prostaglandin E2 (PGE2), which can lead to inflammation in various parts of the body. The synthesis and release of PGE2 is regulated by toll-like receptor 4 (TLR4). DHA has also been shown to reduce tumor size and improve survival rates in mice with breast cancer. DHA is a long-chain polyunsaturated fatty acid that can be found in many types of cells, including neurons. It has been shown to have beneficial effects on neuronal death during experimental models of stroke and traumatic brain injury.Formula:C22H32O2Purity:Min. 95%Color and Shape:PowderMolecular weight:328.49 g/mol


