
CAS 25168-37-0
:Poly(p-phenylenediamine)
Description:
Poly(p-phenylenediamine) (PPD) is a conducting polymer known for its unique electrical and thermal properties. It is synthesized through the oxidative polymerization of p-phenylenediamine, resulting in a material that exhibits high electrical conductivity, making it suitable for applications in electronics, sensors, and as an antistatic agent. PPD is characterized by its dark color, which can vary from brown to black, depending on its oxidation state and degree of polymerization. The polymer is soluble in various organic solvents, which facilitates its processing into films or coatings. Additionally, PPD demonstrates good thermal stability and can withstand elevated temperatures, making it useful in high-performance applications. Its chemical structure, featuring alternating single and double bonds, contributes to its stability and conductivity. However, handling PPD requires caution, as it can be toxic and may cause skin irritation. Overall, poly(p-phenylenediamine) is a versatile material with significant potential in advanced material science and engineering applications.
Formula:(C6H8N2)x
InChI:InChI=1S/C6H8N2/c7-5-1-2-6(8)4-3-5/h1-4H,7-8H2
InChI key:InChIKey=CBCKQZAAMUWICA-UHFFFAOYSA-N
SMILES:NC1=CC=C(N)C=C1
Synonyms:- 1,4-Benzenediamine homopolymer
- 1,4-Benzenediamine, homopolymer
- p-Phenylenediamine polymer
- p-Phenylenediamine, polymers
- Poly(p-diaminophenylene)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
