CAS 25173-23-3

2-Methylene-4-phenyl-3-butenoic acid

Description:

2-Methylene-4-phenyl-3-butenoic acid, with the CAS number 25173-23-3, is an organic compound characterized by its unique structure that features a methylene group adjacent to a phenyl group and a butenoic acid moiety. This compound typically exhibits properties associated with unsaturated carboxylic acids, including the ability to participate in various chemical reactions such as addition and polymerization due to the presence of the double bond. It is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the phenyl group contributes to its aromatic characteristics, which can influence its reactivity and solubility in organic solvents. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and materials science. Its synthesis and applications can vary, but it is often explored in the context of organic synthesis and as a potential intermediate in the production of more complex molecules. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₁₁H₁₀O₂

InChI: InChI=1S/C11H10O2/c1-9(11(12)13)7-8-10-5-3-2-4-6-10/h2-8H,1H2,(H,12,13)

InChI key: InChIKey=UAGWEDHYWOMETI-UHFFFAOYSA-N

SMILES: C(=CC(C(O)=O)=C)C1=CC=CC=C1

Synonyms:

• 2-Methylidene-4-phenylbut-3-enoic acid
• 3-Butenoic acid, 2-methylene-4-phenyl-
• 2-Methylene-4-phenyl-3-butenoic acid
• 2-Styrylacrylic acid