CAS 25173-36-8
:3-(3-methylphenoxy)propanoate
Description:
3-(3-Methylphenoxy)propanoate, identified by its CAS number 25173-36-8, is an organic compound characterized by its ester functional group. It features a propanoate moiety linked to a 3-methylphenoxy group, which contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the aromatic ring. The presence of the methyl group on the phenyl ring can influence its reactivity and stability, potentially affecting its interactions with other chemical species. As an ester, it may undergo hydrolysis in the presence of water, especially under acidic or basic conditions, leading to the formation of the corresponding alcohol and carboxylic acid. 3-(3-Methylphenoxy)propanoate may find applications in various fields, including pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. Its specific characteristics, such as boiling point, melting point, and density, would depend on the molecular structure and environmental conditions.
Formula:C10H11O3
InChI:InChI=1/C10H12O3/c1-8-3-2-4-9(7-8)13-6-5-10(11)12/h2-4,7H,5-6H2,1H3,(H,11,12)/p-1
SMILES:Cc1cccc(c1)OCCC(=O)O
Synonyms:- 3-m-Tolyloxy-propionic acid
- Propanoic acid, 3-(3-methylphenoxy)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Propanoic acid, 3-(3-methylphenoxy)-
CAS:Formula:C10H12O3Purity:98%Color and Shape:SolidMolecular weight:180.20053-(3-Methylphenoxy)propanoic acid
CAS:3-(3-Methylphenoxy)propanoic acidPurity:98%Molecular weight:180.20g/mol3-(3-Methylphenoxy)propanoic acid
CAS:3-(3-Methylphenoxy)propanoic acid (3MPPA) is a phenol with a 3-methyl group substituted for the hydroxyl group. It is a crystalline solid that melts at 96°C and decomposes when heated to 130°C. 3MPPA is a substrate for the enzyme catechol O-methyltransferase, which converts it to 3-O-methyldopa. This reaction occurs in both viable and nonviable cells. The kinetics of this reaction has been studied in detail and it has been shown that 3MPPA preferentially reacts with the active site of catechol O-methyltransferase.Formula:C10H12O3Purity:Min. 95%Molecular weight:180.2 g/mol


