CAS 25173-72-2
:3-(3,4,5-Trimethoxyphenyl)propionic acid
Description:
3-(3,4,5-Trimethoxyphenyl)propionic acid, with the CAS number 25173-72-2, is an organic compound characterized by its propionic acid structure attached to a phenyl group that is further substituted with three methoxy groups at the 3, 4, and 5 positions. This compound typically appears as a white to off-white solid and is soluble in organic solvents, while its solubility in water may be limited due to its hydrophobic character. The presence of multiple methoxy groups enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry and pharmacology. The compound may exhibit various properties such as anti-inflammatory or analgesic effects, which are often investigated in the context of drug development. Its synthesis generally involves the functionalization of phenolic compounds and subsequent reactions to introduce the propionic acid moiety. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards in laboratory settings.
Formula:C12H16O5
InChI:InChI=1S/C12H16O5/c1-15-9-6-8(4-5-11(13)14)7-10(16-2)12(9)17-3/h6-7H,4-5H2,1-3H3,(H,13,14)
InChI key:InChIKey=ZCYXGVJUZBKJAI-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)C(OC)=CC(CCC(O)=O)=C1
Synonyms:- 3,4,5-Trimethoxy-β-phenylpropionic acid
- 3,4,5-Trimethoxybenzenepropanoic acid
- 3,4,5-Trimethoxyhydrocinnamic acid
- 3,4,5-Trimethoxyphenylpropionic acid
- 3-(3,4,5-Trimethoxyphenyl)Propanoate
- 3-(3,4,5-Trimethoxyphenyl)Propanoic Acid
- Benzenepropanoic acid, 3,4,5-trimethoxy-
- Hydrocinnamic acid, 3,4,5-trimethoxy-
- NSC 169988
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
BENZENEPROPANOIC ACID, 3,4,5-TRIMETHOXY-
CAS:Formula:C12H16O5Purity:98%Color and Shape:SolidMolecular weight:240.25243-(3,4,5-Trimethoxyphenyl)Propionic Acid
CAS:3-(3,4,5-Trimethoxyphenyl)Propionic AcidPurity:98%Molecular weight:240.25g/mol3-(3,4,5-Trimethoxyphenyl)propanoic acid, 10mM (in DMSO)
CAS:3-(3,4,5-Trimethoxyphenyl)propanoic acid, 10mM (in DMSO)Purity:≥95%Molecular weight:240.25g/mol3-(3,4,5-Trimethoxyphenyl)propanoic acid
CAS:3-(3,4,5-Trimethoxyphenyl)-propanoic acid is a constituent of Piper retrofractum and Piper longum and is found in herbs and spices.Formula:C12H16O5Purity:97.93%Color and Shape:Almost White PowderMolecular weight:240.253-(3,4,5-Trimethoxyphenyl)propionic acid
CAS:3-(3,4,5-Trimethoxyphenyl)propionic acid (TMPPA) is a monocarboxylic acid that is structurally related to the amino acid lysine. It has been shown to have antinociceptive effects in animals and humans. TMPPA inhibits the production of prostaglandins and nitric oxide, which are inflammatory mediators that induce pain. TMPPA also has nociceptive properties in rats when given intraperitoneally or intrathecally, showing a reduction in locomotor activity. This compound also inhibits protein synthesis by binding to the ribosomal protein S6 kinase-1 (RSK-1), which is the target of many antibiotics used for cancer treatment. TMPPA binds to human serum albumin with high affinity and specificity, suggesting it may be useful as an agent for targeting human blood cells or as an antiobesity drug.Formula:C12H16O5Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:240.25 g/mol3-(3,4,5-Trimethoxyphenyl)propionic acid
CAS:Formula:C12H16O5Purity:98%Color and Shape:SolidMolecular weight:240.255




