CAS 25173-73-3
:2,3-Dimethylbenzenepropanoic acid
Description:
2,3-Dimethylbenzenepropanoic acid, also known as a derivative of benzoic acid, features a propanoic acid group attached to a dimethyl-substituted benzene ring. This compound is characterized by its aromatic structure, which contributes to its stability and reactivity. The presence of the propanoic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The dimethyl substitutions on the benzene ring influence its physical properties, including solubility and boiling point, as well as its reactivity in electrophilic aromatic substitution reactions. Typically, compounds like this may exhibit moderate to low solubility in water but are more soluble in organic solvents. Additionally, the steric hindrance introduced by the methyl groups can affect the compound's reactivity and interaction with other molecules. Overall, 2,3-Dimethylbenzenepropanoic acid is of interest in organic synthesis and may have applications in pharmaceuticals or as an intermediate in chemical manufacturing.
Formula:C11H14O2
InChI:InChI=1S/C11H14O2/c1-8-4-3-5-10(9(8)2)6-7-11(12)13/h3-5H,6-7H2,1-2H3,(H,12,13)
InChI key:InChIKey=CUKGYBNTGJFOLQ-UHFFFAOYSA-N
SMILES:C(CC(O)=O)C1=C(C)C(C)=CC=C1
Synonyms:- Hydrocinnamic acid, 2,3-dimethyl-
- 2,3-Dimethyl-β-phenylpropionic acid
- 2,3-Dimethylbenzenepropanoic acid
- Benzenepropanoic acid, 2,3-dimethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-(2',3'-Dimethylphenyl)propionic acid
CAS:<p>3-(2',3'-Dimethylphenyl)propionic acid is a prostaglandin compound that inhibits the production of vasoconstricting and vasodilating substances. It belongs to the class of amide, benzoic acid, and azacyclic compounds. The structural formula is CHCOOH. 3-(2',3'-Dimethylphenyl)propionic acid inhibits the response of cells to agonists such as histamine, serotonin, and bradykinin by binding to specific receptors on cell surfaces called integrins. This compound has been shown to have vasospastic effects in patients with Raynaud's phenomenon or other diseases involving vasospasm. 3-(2',3'-Dimethylphenyl)propionic acid also has thrombotic effects due to its inhibition of blood coagulation factors IIa and Xa.</p>Formula:C11H14O2Purity:Min. 95%Molecular weight:178.23 g/mol
