CAS 25173-75-5

2,5-Dimethylbenzenepropanoic acid

Description:

2,5-Dimethylbenzenepropanoic acid, also known as a derivative of benzoic acid, features a propanoic acid group attached to a dimethyl-substituted benzene ring. This compound is characterized by its aromatic structure, which contributes to its stability and reactivity. The presence of the propanoic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The dimethyl substitutions on the benzene ring influence its physical properties, such as solubility and boiling point, making it less polar compared to other carboxylic acids. Typically, compounds like this exhibit moderate to low solubility in water but may dissolve in organic solvents. Its applications can range from use in organic synthesis to potential roles in pharmaceuticals or agrochemicals, depending on the specific reactivity and functionalization of the molecule. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₁H₁₄O₂

InChI: InChI=1S/C11H14O2/c1-8-3-4-9(2)10(7-8)5-6-11(12)13/h3-4,7H,5-6H2,1-2H3,(H,12,13)

InChI key: InChIKey=YJUKGBIRIXQUJY-UHFFFAOYSA-N

SMILES: C(CC(O)=O)C1=C(C)C=CC(C)=C1

Synonyms:

• 2,5-Dimethylbenzenepropanoic acid
• 2,5-Dimethyl-β-phenylpropionic acid
• Hydrocinnamic acid, 2,5-dimethyl-
• Benzenepropanoic acid, 2,5-dimethyl-
• 3-(2,5-Dimethylphenyl)propanoic acid

Benzenepropanoic acid, 2,5-dimethyl-

CAS: 25173-75-5

Formula: C₁₁H₁₄O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 178.2277

Ref: IN-DA002QQQ

3-(2,5-Dimethylphenyl)propionic acid

CAS: 25173-75-5

3-(2,5-Dimethylphenyl)propionic acid

Molecular weight: 178.22766g/mol

Ref: 54-OR1021334

3-(2,5-Dimethylphenyl)propionic acid

CAS: 25173-75-5

Formula: C₁₁H₁₄O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 178.231

Ref: 10-F045103

3-(2,5-Dimethylphenyl)propionic acid

CAS: 25173-75-5

3-(2,5-Dimethylphenyl)propionic acid is a cytotoxic agent that belongs to the group of carboxamides. It is lipophilic and has been shown to be effective against colon tumor cells in vivo. 3-(2,5-Dimethylphenyl)propionic acid binds to DNA chains and inhibits cellular proliferation by inhibiting the synthesis of nucleic acids. This agent also inhibits the activity of topoisomerases I and II, which are enzymes that are necessary for DNA replication and transcription. 3-(2,5-Dimethylphenyl)propionic acid has been shown to have a high cytotoxic potency in vitro but low potency against cultured human cells.

Formula: C₁₁H₁₄O₂

Purity: Min. 95%

Molecular weight: 178.23 g/mol

Ref: 3D-ABA17375