CAS 25178-38-5
:amino(2-hydroxyphenyl)acetic acid
Description:
Amino(2-hydroxyphenyl)acetic acid, also known as 2-hydroxyphenylalanine, is an amino acid derivative characterized by the presence of both an amino group and a hydroxyl group on a phenyl ring. This compound features a carboxylic acid functional group, which contributes to its acidic properties. It is typically a white to off-white crystalline solid that is soluble in water due to the polar nature of its functional groups. The presence of the hydroxyl group enhances its reactivity and potential for hydrogen bonding, making it an interesting candidate for various biochemical applications. This compound may play a role in metabolic pathways and can be involved in the synthesis of neurotransmitters. Its structural characteristics allow it to participate in various chemical reactions, including esterification and amidation. Additionally, it may exhibit biological activity, making it relevant in pharmaceutical research and development. Overall, amino(2-hydroxyphenyl)acetic acid is a versatile compound with potential applications in both chemistry and biochemistry.
Formula:C8H9NO3
InChI:InChI=1/C8H9NO3/c9-7(8(11)12)5-3-1-2-4-6(5)10/h1-4,7,10H,9H2,(H,11,12)
SMILES:c1ccc(c(c1)C(C(=O)O)N)O
Synonyms:- Benzeneacetic Acid, Alpha-Amino-2-Hydroxy-
- Hydroxyphenyl glycine
- 2-Amino-2-(2-Hydroxyphenyl)Acetic Acid
- 2-(2-Hydroxyphenyl)glycine
- Amino(2-hydroxyphenyl)acetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzeneacetic acid, α-amino-2-hydroxy-
CAS:Formula:C8H9NO3Purity:97%Color and Shape:SolidMolecular weight:167.16202-Amino-2-(2-hydroxyphenyl)acetic acid
CAS:Formula:C8H9NO3Purity:97%Color and Shape:ClearMolecular weight:167.164alpha-Amino-2-hydroxybenzeneacetic Acid
CAS:Controlled ProductApplications α-Amino-2-hydroxybenzeneacetic Acid was studied for its role in treating, preventing or improving nonalcoholic fatty liver disease.
References Rathmacher, John, et al.: PCT Int. Appl., WO 2018048932 A1 20180315 (2018)Formula:C8H9NO3·HClColor and Shape:NeatMolecular weight:203.623



