CAS 25179-61-7
:dipropylcarbamodithioic acid
Description:
Dipropylcarbamodithioic acid is an organosulfur compound characterized by its unique structure, which includes a carbamodithioic acid functional group attached to two propyl chains. This compound typically appears as a viscous liquid or solid, depending on temperature and purity. It is known for its role as a chelating agent, particularly in coordination chemistry, where it can form complexes with various metal ions. The presence of sulfur atoms in its structure contributes to its reactivity and potential applications in agriculture as a pesticide or herbicide. Additionally, dipropylcarbamodithioic acid may exhibit properties such as low volatility and moderate solubility in organic solvents, making it useful in various industrial applications. Safety considerations are important when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate protective measures should be taken. Overall, dipropylcarbamodithioic acid is a versatile chemical with applications in both research and industry, particularly in fields requiring metal ion coordination.
Formula:C7H15NS2
InChI:InChI=1/C7H15NS2/c1-3-5-8(6-4-2)7(9)10/h3-6H2,1-2H3,(H,9,10)
Synonyms:- Carbamodithioic acid, dipropyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
