CAS 25187-00-2
:2-Iodobenzophenone
Description:
2-Iodobenzophenone is an organic compound characterized by its structure, which consists of a benzophenone core with an iodine atom substituted at the 2-position of one of the phenyl rings. This compound typically appears as a pale yellow solid and is known for its role as a photoinitiator in polymer chemistry, particularly in UV-curable systems. It exhibits moderate solubility in organic solvents such as ethanol and acetone, while being less soluble in water. The presence of the iodine atom enhances its reactivity, making it useful in various chemical reactions, including those involving radical mechanisms. Additionally, 2-iodobenzophenone can undergo photochemical transformations upon exposure to UV light, leading to the generation of reactive species. Its applications extend to fields such as materials science, organic synthesis, and photochemistry. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate protective equipment should be used.
Formula:C13H9IO
InChI:InChI=1/C13H9IO/c14-12-9-5-4-8-11(12)13(15)10-6-2-1-3-7-10/h1-9H
SMILES:c1ccc(cc1)C(=O)c1ccccc1I
Synonyms:- (2-Iodophenyl)(Phenyl)Methanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methanone, (2-iodophenyl)phenyl-
CAS:Formula:C13H9IOPurity:98%Color and Shape:LiquidMolecular weight:308.11442-Iodobenzophenone
CAS:2-Iodobenzophenone is an organic compound that has a chloride and sodium carbonate functional group. It is used as a catalyst to stabilize reactions with halides and nitro groups, which are often found in organics. 2-Iodobenzophenone can also be used to increase the reaction time of organic reactions. This molecule has been shown to have antibonding interactions with nitro groups and halides, making it a good model system for studying such interactions. 2-Iodobenzophenone is not toxic to kidney cells, making it a possible candidate for use in drug development.Formula:C13H9IOPurity:Min. 95%Molecular weight:308.11 g/mol2-Iodobenzophenone
CAS:2-Iodobenzophenone is a high quality, complex compound that is used as a reagent in organic synthesis and as a useful intermediate for the production of fine chemicals.
Formula:C13H9IOPurity:Min. 90.0%Molecular weight:308.11 g/mol



