CAS 25189-69-9
:Poly(styrene oxide)
Description:
Poly(styrene oxide) is a polymer derived from the epoxidation of polystyrene, characterized by the presence of epoxide groups within its structure. This substance exhibits a combination of properties typical of both polystyrene and epoxide compounds. It is generally a solid at room temperature and can be processed into various forms, including films and coatings. Poly(styrene oxide) is known for its chemical resistance, thermal stability, and mechanical strength, making it suitable for applications in adhesives, coatings, and as a matrix for composite materials. The presence of epoxide groups allows for further chemical modifications, enhancing its versatility in various chemical reactions. Additionally, poly(styrene oxide) can exhibit good adhesion properties and is often used in formulations requiring enhanced durability and performance. However, like many polymers, its properties can vary significantly based on molecular weight, degree of cross-linking, and processing conditions. Safety considerations should be taken into account, as with any chemical substance, particularly regarding its handling and potential environmental impact.
Formula:(C8H8O)x
InChI:InChI=1S/C8H8O/c1-2-4-7(5-3-1)8-6-9-8/h1-5,8H,6H2
InChI key:InChIKey=AWMVMTVKBNGEAK-UHFFFAOYSA-N
SMILES:C1(CO1)C2=CC=CC=C2
Synonyms:- Oxirane, 2-phenyl-, homopolymer
- Oxirane, phenyl-, homopolymer
- Poly(styrene oxide)
- Poly(phenylethylene oxide)
- Benzene, (epoxyethyl)-, polymers
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
