CAS 2519-10-0: Pentaphenylcyclopentadiene
Description:Pentaphenylcyclopentadiene, with the CAS number 2519-10-0, is an organic compound characterized by its unique structure, which features a cyclopentadiene core substituted with five phenyl groups. This compound exhibits notable stability due to the presence of these bulky phenyl groups, which sterically hinder the reactivity of the cyclopentadiene moiety. Pentaphenylcyclopentadiene is typically a solid at room temperature and is known for its distinctive color and potential applications in organic synthesis and materials science. The compound can participate in various chemical reactions, including Diels-Alder reactions, due to the presence of conjugated double bonds in the cyclopentadiene structure. Its properties, such as solubility and melting point, can vary depending on the solvent and environmental conditions. Additionally, pentaphenylcyclopentadiene serves as a model compound for studying the effects of steric hindrance and electronic interactions in organic chemistry. Overall, its unique structural features and reactivity make it a subject of interest in both academic and industrial research.
Formula:C35H26
InChI:InChI=1/C35H26/c1-6-16-26(17-7-1)31-32(27-18-8-2-9-19-27)34(29-22-12-4-13-23-29)35(30-24-14-5-15-25-30)33(31)28-20-10-3-11-21-28/h1-25,31H
- Synonyms:
- (2,3,4,5-Tetraphenyl-2,4-cyclopentadien-1-yl)benzene
- 1,1',1'',1''',1''''-Cyclopenta-1,3-diene-1,2,3,4,5-pentaylpentabenzene
- 1,2,3,4,5-Pentaphenyl-1,3-cyclopentadiene
- 2519-10-0

1,2,3,4,5-Pentaphenyl-1,3-cyclopentadiene
Ref: 3B-P1633
100mg | 25.00 € |

Benzene, 1,1',1'',1''',1''''-(1,3-cyclopentadiene-1,2,3,4,5-pentayl)pentakis-
Ref: IN-DA002QTD
1g | 198.00 € | ||
100mg | 59.00 € | ||
250mg | 95.00 € |

Cyclopenta-1,3-Diene-1,2,3,4,5-Pentaylpentabenzene
Ref: 54-OR1012739
1g | 171.00 € | ||
5g | 720.00 € | ||
25g | 3,135.00 € | ||
100mg | 38.00 € | ||
250mg | 67.00 € |

1,2,3,4,5-Pentaphenyl-1,3-cyclopentadiene, 99%
Ref: 08-06-1296
1g | Discontinued | Request information | |
5g | Discontinued | Request information |

1,2,3,4,5-Pentaphenyl-1,3-cyclopentadiene
Ref: 3D-FP60824
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |