CAS 25195-49-7

1-[(Methylsulfonyl)methyl]-3-(trifluoromethyl)benzene

Description:

1-[(Methylsulfonyl)methyl]-3-(trifluoromethyl)benzene, with the CAS number 25195-49-7, is an organic compound characterized by its unique functional groups and structural features. It contains a benzene ring substituted with a trifluoromethyl group and a methylsulfonylmethyl group, which contribute to its chemical reactivity and physical properties. The presence of the trifluoromethyl group typically enhances the compound's lipophilicity and can influence its biological activity, while the methylsulfonyl group may impart polar characteristics, affecting solubility in various solvents. This compound is likely to exhibit moderate volatility and may have applications in pharmaceuticals or agrochemicals due to its potential biological activity. Additionally, the sulfonyl group can participate in various chemical reactions, making it a versatile building block in organic synthesis. Safety data should be consulted for handling and usage, as compounds with trifluoromethyl groups can sometimes exhibit toxicity or environmental persistence. Overall, this compound represents a class of aromatic sulfonyl compounds with interesting chemical properties.

Formula: C₉H₉F₃O₂S

InChI: InChI=1S/C9H9F3O2S/c1-15(13,14)6-7-3-2-4-8(5-7)9(10,11)12/h2-5H,6H2,1H3

InChI key: InChIKey=GSGHVVYVFJQASI-UHFFFAOYSA-N

SMILES: C(S(C)(=O)=O)C1=CC(C(F)(F)F)=CC=C1

Synonyms:

• Benzene, 1-[(methylsulfonyl)methyl]-3-(trifluoromethyl)-
• Sulfone, methyl m-(trifluoromethyl)benzyl
• 1-[(Methylsulfonyl)methyl]-3-(trifluoromethyl)benzene

3-Trifluoromethylbenzylmethylsulfone

CAS: 25195-49-7

Formula: C₉H₉F₃O₂S

Purity: 97.0%

Color and Shape: Solid

Molecular weight: 238.22

Ref: 10-F024353