CAS 2520-24-3
:methyl 6,8-dideoxy-6-[(4-ethyl-1-methylprolyl)amino]-1-thiooctopyranoside
Description:
Methyl 6,8-dideoxy-6-[(4-ethyl-1-methylprolyl)amino]-1-thiooctopyranoside, identified by its CAS number 2520-24-3, is a complex organic compound characterized by its unique structural features. It contains a thioether functional group, which contributes to its reactivity and potential biological activity. The presence of a methyl group and a prolyl amino substituent suggests that this compound may exhibit specific interactions with biological systems, possibly influencing its pharmacological properties. The dideoxy nature of the molecule indicates that it lacks hydroxyl groups at the 6 and 8 positions, which can affect its solubility and stability. This compound may be of interest in medicinal chemistry, particularly in the development of glycosylated drugs or as a potential lead compound in the search for new therapeutic agents. Its structural complexity and the presence of various functional groups suggest that it could participate in diverse chemical reactions, making it a subject of interest for further research in organic synthesis and drug development.
Formula:C17H32N2O6S
InChI:InChI=1/C17H32N2O6S/c1-5-9-6-10(19(3)7-9)16(24)18-11(8(2)20)15-13(22)12(21)14(23)17(25-15)26-4/h8-15,17,20-23H,5-7H2,1-4H3,(H,18,24)/t8-,9-,10+,11-,12+,13-,14-,15-,17-/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Lincomycin-B
CAS:Lincomycin-B is a lincosamide antibiotic isolated from the actinomycete Streptomyces lincolnensis.Formula:C17H32N2O6SPurity:98%Color and Shape:SolidMolecular weight:392.51Lincomycin B
CAS:Lincomycin B is a chemical compound that belongs to the group of antimicrobial agents. It is used in the treatment of viral infections and has been shown to have an effect against HIV-1, herpes simplex virus, and influenza A virus. Lincomycin B inhibits protein synthesis by binding to the ribosomes in bacteria and inhibiting peptide elongation. The optimum concentration for this compound is 0.2 mM with a minimum inhibitory concentration of 1 mM. Lincomycin B can be synthesized by reacting sodium hydroxide solution with hydrochloric acid or hydroxide solution at a temperature range from 30 °C to 70 °C.Formula:C17H32N2O6SPurity:Min. 95%Molecular weight:392.51 g/mol




