CAS 252004-45-8

4-Chloro-2,6-difluorobenzaldehyde

Description:

4-Chloro-2,6-difluorobenzaldehyde is an aromatic aldehyde characterized by the presence of a benzene ring substituted with a chlorine atom and two fluorine atoms, along with an aldehyde functional group. Its molecular formula is C7H4ClF2O, indicating a relatively simple structure with a moderate molecular weight. The compound typically appears as a colorless to pale yellow liquid or solid, depending on temperature and purity. It is known for its reactivity due to the aldehyde group, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The presence of electronegative fluorine and chlorine atoms influences its electronic properties, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, 4-Chloro-2,6-difluorobenzaldehyde may exhibit specific physical properties such as boiling and melting points, which are influenced by its molecular structure and substituents. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.

Formula: C₇H₃ClF₂O

InChI: InChI=1/C7H3ClF2O/c8-4-1-6(9)5(3-11)7(10)2-4/h1-3H

SMILES: c1c(cc(c(C=O)c1F)F)Cl

Synonyms:

• 252004-45-8
• Benzaldehyde, 4-chloro-2,6-difluoro-
• Vhr Dg Bf Ff

Benzaldehyde, 4-chloro-2,6-difluoro-

CAS: 252004-45-8

Formula: C₇H₃ClF₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 176.5479

Ref: IN-DA002QWG

4-Chloro-2,6-difluorobenzaldehyde

CAS: 252004-45-8

4-Chloro-2,6-difluorobenzaldehyde

Formula: C₇H₃ClF₂O

Purity: 98%

Color and Shape: white powder

Molecular weight: 176.55g/mol

Ref: 54-PC8238

4-Chloro-2,6-difluorobenzaldehyde

CAS: 252004-45-8

Formula: C₇H₃ClF₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 176.55

Ref: 10-F043168