CAS 252025-52-8
:1-[(2,4-Dichlorophenyl)methyl]-1H-indazole-3-carboxylic acid hydrazide
Description:
1-[(2,4-Dichlorophenyl)methyl]-1H-indazole-3-carboxylic acid hydrazide is a chemical compound characterized by its complex structure, which includes an indazole core, a carboxylic acid functional group, and a hydrazide moiety. This compound typically exhibits properties associated with both hydrazides and indazole derivatives, such as potential biological activity, including anti-inflammatory or antimicrobial effects. The presence of the 2,4-dichlorophenyl group may enhance its lipophilicity and influence its interaction with biological targets. The compound is likely to be solid at room temperature and may have moderate solubility in organic solvents, depending on the specific substituents and their arrangement. Its synthesis often involves multi-step organic reactions, and it may be of interest in medicinal chemistry for the development of new therapeutic agents. As with many chemical substances, safety data should be consulted to understand its handling, storage, and potential hazards.
Formula:C15H12Cl2N4O
InChI:InChI=1S/C15H12Cl2N4O/c16-10-6-5-9(12(17)7-10)8-21-13-4-2-1-3-11(13)14(20-21)15(22)19-18/h1-7H,8,18H2,(H,19,22)
InChI key:InChIKey=VENCPJAAXKBIJD-UHFFFAOYSA-N
SMILES:C(N1C=2C(C(C(NN)=O)=N1)=CC=CC2)C3=C(Cl)C=C(Cl)C=C3
Synonyms:- 1-(2,4-Dichlorobenzyl)Indazole-3-Carbohydrazide
- 1-[(2,4-Dichlorophenyl)methyl]-1H-indazole-3-carboxylic acid hydrazide
- 1H-Indazole-3-carboxylic acid, 1-[(2,4-dichlorophenyl)methyl]-, hydrazide
- Adjudin
- Af-2364
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1H-Indazole-3-carboxylic acid, 1-[(2,4-dichlorophenyl)methyl]-, hydrazide
CAS:Formula:C15H12Cl2N4OPurity:99%Molecular weight:335.1880Adjudin
CAS:Adjudin (AF-2364) is a small molecule compound known to possess antispermatogenic function, attenuates microglia activation by suppression of the NF-κB pathway.Formula:C15H12Cl2N4OPurity:96.51% - ≥95%Color and Shape:SolidMolecular weight:335.19Adjudin
CAS:Controlled ProductAdjudin is a drug that binds to the energy metabolism protein Adjudin and inhibits its function. It has been shown to have a long-term toxicity effect on rat sertoli cells, which is due to its inhibition of drug transport. The contraceptive effects are mediated by its ability to inhibit cell division in meiosis, leading to reduced sperm production. Adjudin has also been shown to have DNA binding activity in vitro and epithelium-specific cytotoxicity in vivo.Formula:C15H12Cl2N4OPurity:Min. 95%Molecular weight:335.19 g/mol


