
CAS 252027-00-2
:N-(2,4-Difluorophenyl)-3-(2-nitrophenoxy)-2-thiophenecarboxamide
Description:
N-(2,4-Difluorophenyl)-3-(2-nitrophenoxy)-2-thiophenecarboxamide, with the CAS number 252027-00-2, is a synthetic organic compound characterized by its complex molecular structure, which includes a thiophene ring, a carboxamide functional group, and multiple aromatic substituents. The presence of the difluorophenyl and nitrophenoxy groups contributes to its unique electronic properties and potential biological activity. This compound is typically studied for its applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Its molecular structure suggests potential for lipophilicity, which may influence its solubility and permeability in biological systems. Additionally, the presence of electron-withdrawing groups like nitro and fluorine can enhance its reactivity and stability under certain conditions. Overall, this compound exemplifies the intricate design often found in drug development, where specific functional groups are strategically incorporated to achieve desired pharmacological effects.
Formula:C17H10F2N2O4S
InChI:InChI=1S/C17H10F2N2O4S/c18-10-5-6-12(11(19)9-10)20-17(22)16-15(7-8-26-16)25-14-4-2-1-3-13(14)21(23)24/h1-9H,(H,20,22)
InChI key:InChIKey=HKGNKXQMHNMFRP-UHFFFAOYSA-N
SMILES:C(NC1=C(F)C=C(F)C=C1)(=O)C2=C(OC3=C(N(=O)=O)C=CC=C3)C=CS2
Synonyms:- N-(2,4-Difluorophenyl)-3-(2-nitrophenoxy)-2-thiophenecarboxamide
- 2-Thiophenecarboxamide, N-(2,4-difluorophenyl)-3-(2-nitrophenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.