CAS 25205-16-7

4-Hydroxy-4′-methoxy[1,1′-biphenyl]-3-carboxylic acid

Description:

4-Hydroxy-4′-methoxy[1,1′-biphenyl]-3-carboxylic acid, with the CAS number 25205-16-7, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a hydroxyl group (-OH) and a methoxy group (-OCH₃) attached to the biphenyl framework, as well as a carboxylic acid group (-COOH) at the 3-position. These functional groups contribute to its chemical reactivity and solubility properties. The presence of the hydroxyl and carboxylic acid groups makes it a potential candidate for hydrogen bonding, influencing its solubility in polar solvents. Additionally, the methoxy group can affect the electronic properties of the molecule, potentially enhancing its reactivity in various chemical reactions. This compound may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis due to its unique structural features and functional groups. Its stability and reactivity can be influenced by environmental factors such as pH and temperature.

Formula: C₁₄H₁₂O₄

InChI: InChI=1S/C14H12O4/c1-18-11-5-2-9(3-6-11)10-4-7-13(15)12(8-10)14(16)17/h2-8,15H,1H3,(H,16,17)

InChI key: InChIKey=BMJWQWVQGHSPSF-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(C=CC1O)C2=CC=C(OC)C=C2

Synonyms:

• 3-Biphenylcarboxylic acid, 4-hydroxy-4′-methoxy-
• 2-Hydroxy-5-(4-methoxyphenyl)benzoic acid
• 4-Hydroxy-4′-methoxy[1,1′-biphenyl]-3-carboxylic acid
• [1,1′-Biphenyl]-3-carboxylic acid, 4-hydroxy-4′-methoxy-

4-Hydroxy-4'-methoxy[1,1'-biphenyl]-3-carboxylic acid

CAS: 25205-16-7

4-Hydroxy-4'-methoxy[1,1'-biphenyl]-3-carboxylic acid

Purity: ≥95%

Ref: 54-OR7428

4-Hydroxy-4′-methoxy-biphenyl-3-carboxylic acid

CAS: 25205-16-7

Formula: C₁₄H₁₂O₄

Molecular weight: 244.246

Ref: 10-F031937