CAS 252054-88-9
:1-(trimethylsilyl)naphthalen-2-yl trifluoromethanesulfonate
Description:
1-(Trimethylsilyl)naphthalen-2-yl trifluoromethanesulfonate, with the CAS number 252054-88-9, is an organosilicon compound that features a naphthalene ring substituted with a trimethylsilyl group and a trifluoromethanesulfonate moiety. This compound is characterized by its high reactivity, particularly in nucleophilic substitution reactions, due to the presence of the trifluoromethanesulfonate group, which acts as a good leaving group. The trimethylsilyl group enhances the solubility of the compound in organic solvents and can also influence its electronic properties, making it useful in various synthetic applications. The presence of the naphthalene structure contributes to its aromatic character, which can affect its stability and reactivity. This compound is typically used in organic synthesis, particularly in the formation of carbon-carbon bonds and in the development of more complex molecular architectures. Its unique combination of functional groups allows for versatility in chemical transformations, making it a valuable reagent in the field of organic chemistry.
Formula:C14H15F3O3SSi
InChI:InChI=1/C14H15F3O3SSi/c1-22(2,3)13-11-7-5-4-6-10(11)8-9-12(13)20-21(18,19)14(15,16)17/h4-9H,1-3H3
SMILES:C[Si](C)(C)c1c2ccccc2ccc1OS(=O)(=O)C(F)(F)F
Synonyms:- 1-(Trimethylsilyl)-2-naphthyl Trifluoromethanesulfonate
- 1-(TRIMETHYLSILYL)-2-NAPHTHYL TRIFLATE
- 1-(TRIMETHYLSILYL)-2-NAPHTHYL TRIFLUOROMETHANESULFONATE,96.0+%(GC)
- Methanesulfonic acid, 1,1,1-trifluoro-, 1-(trimethylsilyl)-2-naphthalenyl ester
- (1-trimethylsilylnaphthalen-2-yl)trifluoromethanesulfonate
- Trifluoromethanesulfonic Acid 1-(Trimethylsilyl)-2-naphthyl Ester
- 1-(Trimethylsilyl)-2-naphthyl Triflate
- 1-(trimethylsilyl)-2-naphthyl trifluoromethansulfonate
- Methanesulfonic acid, trifluoro-, 1-(triMethylsilyl)-2-naphthalenyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methanesulfonic acid, 1,1,1-trifluoro-, 1-(trimethylsilyl)-2-naphthalenyl ester
CAS:Formula:C14H15F3O3SSiPurity:96%Color and Shape:LiquidMolecular weight:348.41281-(Trimethylsilyl)-2-Naphthyl Trifluoromethanesulfonate
CAS:1-(Trimethylsilyl)-2-Naphthyl TrifluoromethanesulfonatePurity:96%Molecular weight:348.41g/mol1-(Trimethylsilyl)-2-naphthyl Trifluoromethanesulfonate
CAS:Formula:C14H15F3O3SSiPurity:>96.0%(GC)Color and Shape:Colorless to Light yellow to Light orange clear liquidMolecular weight:348.411-(Trimethylsilyl)-2-naphthyl Trifluoromethanesulfonate
CAS:1-(Trimethylsilyl)-2-naphthyl Trifluoromethanesulfonate is a solvent that has been used for the synthesis of oxygen heterocycles. It is also used as a reagent to cleave bonds in organic molecules, such as alkene, solvents, aldehydes and activated esters. This compound is an unsymmetrical nucleophile that reacts with electron-poor alkenes to generate an unsaturated bond between two carbons. Mechanistic studies have shown that the reaction proceeds through a concerted mechanism involving the formation of a covalent phosphine intermediate.
Formula:C14H15F3O3SSiPurity:Min. 95%Color and Shape:PowderMolecular weight:348.41 g/molRef: 3D-FT60048
Discontinued product



