CAS 252056-70-5

5-Amino-3-methylpyridine-2-carbonitrile

Description:

5-Amino-3-methylpyridine-2-carbonitrile is an organic compound characterized by its pyridine ring structure, which features an amino group and a cyano group. This compound has a molecular formula that reflects the presence of both nitrogen and carbon functionalities, making it a versatile intermediate in organic synthesis. The amino group (-NH2) contributes to its basicity and potential reactivity, while the cyano group (-C≡N) can participate in nucleophilic addition reactions and serve as a precursor for various derivatives. The methyl group at the 3-position of the pyridine ring influences the compound's steric and electronic properties, affecting its reactivity and solubility. Typically, compounds like this are of interest in pharmaceutical chemistry and materials science due to their potential applications in drug development and as building blocks for more complex molecules. Additionally, the presence of multiple functional groups allows for diverse chemical transformations, making it a valuable compound in synthetic organic chemistry.

Formula: C₇H₇N₃

InChI: InChI=1/C7H7N3/c1-5-2-6(9)4-10-7(5)3-8/h2,4H,9H2,1H3

SMILES: Cc1cc(cnc1C#N)N

Synonyms:

• 2-Pyridinecarbonitrile, 5-Amino-3-Methyl-

2-Pyridinecarbonitrile, 5-amino-3-methyl-

CAS: 252056-70-5

Formula: C₇H₇N₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 133.1506

Ref: IN-DA002QWT

5-Amino-2-cyano-3-methylpyridine

CAS: 252056-70-5

5-Amino-2-cyano-3-methylpyridine

Formula: C₇H₇N₃

Purity: ≥95%

Color and Shape: pale yellow solid

Molecular weight: 133.15g/mol

Ref: 54-OR345307

5-Amino-3-methylpicolinonitrile

CAS: 252056-70-5

Formula: C₇H₇N₃

Purity: 97%

Molecular weight: 133.154

Ref: 10-F223046