CAS 2521-01-9
:ethyl N-benzyl-N-cyclopropylcarbamate
Description:
Ethyl N-benzyl-N-cyclopropylcarbamate, with the CAS number 2521-01-9, is an organic compound characterized by its carbamate functional group. It features an ethyl ester linked to a benzyl and a cyclopropyl group, contributing to its unique chemical properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. Ethyl N-benzyl-N-cyclopropylcarbamate is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological systems. Its structure allows for various interactions, making it a candidate for further research in drug design. The compound's stability, solubility, and reactivity can vary based on environmental conditions and the presence of other substances. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled. Proper storage and disposal methods are essential to mitigate any potential hazards associated with this chemical.
Formula:C13H17NO2
InChI:InChI=1/C13H17NO2/c1-2-16-13(15)14(12-8-9-12)10-11-6-4-3-5-7-11/h3-7,12H,2,8-10H2,1H3
Synonyms:- ethyl benzyl(cyclopropyl)carbamate
- encyprate
- Cyclopropylbenzylcarbamic acid ethyl ester
- N-Benzyl-N-cyclopropylcarbamic acid ethyl ester
- CarbaMic acid, N-cyclopropyl-N-(phenylMethyl)-, ethyl ester
- N-Benzylcyclopropanecarbamic acid ethyl ester
- ethyl N-benzyl-N-cyclopropylcarbamate
- MO-1255
- ethyl N-cyclopropyl-N-(phenylmethyl)carbamate
- A-19757
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
