CAS 25218-22-8
:methyl (3S,4S,5S,6S)-3,4,5-triacetoxy-6-(4-aminophenoxy)tetrahydropyran-2-carboxylate
Description:
Methyl (3S,4S,5S,6S)-3,4,5-triacetoxy-6-(4-aminophenoxy)tetrahydropyran-2-carboxylate is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. The presence of multiple acetoxy groups indicates that it has significant reactivity and potential for further chemical modifications. The compound also features an amino group attached to a phenoxy moiety, which can enhance its solubility and biological activity. The stereochemistry denoted by the (3S,4S,5S,6S) configuration suggests that it has specific spatial arrangements that may influence its interactions in biological systems. This compound may be of interest in medicinal chemistry due to its structural features, which could contribute to its pharmacological properties. Additionally, the methyl ester functional group indicates that it may undergo hydrolysis to release the corresponding carboxylic acid, potentially affecting its bioavailability and activity. Overall, this compound exemplifies the complexity and diversity of organic molecules used in various chemical and pharmaceutical applications.
Formula:C19H23NO10
InChI:InChI=1/C19H23NO10/c1-9(21)26-14-15(27-10(2)22)17(28-11(3)23)19(30-16(14)18(24)25-4)29-13-7-5-12(20)6-8-13/h5-8,14-17,19H,20H2,1-4H3/t14-,15-,16?,17-,19+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Aminophenyl 2,3,4-Tri-O-acetyl-b-D-glucuronide Methyl Ester
CAS:Formula:C19H23NO10Color and Shape:SolidMolecular weight:425.38664-Aminophenyl 2,3,4-Tri-O-acetyl-β-D-glucuronide Methyl Ester
CAS:Controlled ProductFormula:C19H23NO10Color and Shape:Light BrownMolecular weight:425.394-Aminophenyl 2,3,4-tri-O-acetyl-b-D-glucuronide methyl ester
CAS:<p>4-Aminophenyl 2,3,4-tri-O-acetyl-b-D-glucuronide methyl ester is an organic compound that belongs to the group of Modifications. It is a colorless solid with a melting point of about 200. °C. This product is used in the synthesis of oligosaccharides and carbohydrates. The molecular formula for 4-aminophenyl 2,3,4-tri-O-acetyl-b-D-glucuronide methyl ester is C8H14N2O5 and its molecular weight is 240.24 g/mol. The CAS Registry Number (RN) for this product is 25218-22-8 and its EINECS number is 249 3 578 - 7 .</p>Formula:C19H23NO10Purity:Min. 95%Molecular weight:425.39 g/mol



