CAS 252186-80-4

Benzoic acid, 2,3-dichloro-, anhydride with 2,3-dichlorobenzoic acid

Description:

Benzoic acid, 2,3-dichloro-, anhydride with 2,3-dichlorobenzoic acid, identified by CAS number 252186-80-4, is a chemical compound characterized by its anhydride structure derived from benzoic acid and 2,3-dichlorobenzoic acid. This compound features two chlorine substituents on the benzene ring, which influence its reactivity and physical properties. Typically, such chlorinated benzoic acid derivatives exhibit increased lipophilicity and may demonstrate enhanced biological activity compared to their non-chlorinated counterparts. The presence of the anhydride functional group suggests that this compound can participate in acylation reactions, making it useful in organic synthesis and potentially in the development of pharmaceuticals or agrochemicals. Additionally, the chlorinated nature of the compound may impart specific characteristics such as increased stability or altered solubility in various solvents. Safety and handling precautions are essential due to the potential toxicity associated with chlorinated organic compounds. Overall, this compound represents a specialized class of chemicals with applications in various fields, including medicinal chemistry and materials science.

Formula: C₁₄H₆Cl₄O₃

InChI: InChI=1S/C14H6Cl4O3/c15-9-5-1-3-7(11(9)17)13(19)21-14(20)8-4-2-6-10(16)12(8)18/h1-6H

InChI key: InChIKey=PQQZYNVQDUZLTQ-UHFFFAOYSA-N

SMILES: C(OC(=O)C1=C(Cl)C(Cl)=CC=C1)(=O)C2=C(Cl)C(Cl)=CC=C2

Synonyms:

• 2,3-Dichlorobenzoic anhydride
• Benzoic acid, 2,3-dichloro-, anhydride
• Benzoic acid, 2,3-dichloro-, anhydride with 2,3-dichlorobenzoic acid

2,3-Dichlorobenzoic acid anhydride

CAS: 252186-80-4

Please enquire for more information about 2,3-Dichlorobenzoic acid anhydride including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₄H₆Cl₄O₃

Purity: Min. 95%

Molecular weight: 364 g/mol

Ref: 3D-CKA18680