CAS 252206-28-3: 4-(Fmoc-amino)-1-methyl-1H-Imidazole-2-carboxylic Acid
Description:4-(Fmoc-amino)-1-methyl-1H-imidazole-2-carboxylic acid is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of the Fmoc (9-fluorenylmethoxycarbonyl) group indicates that this compound is likely used in peptide synthesis as a protective group for amino acids, allowing for selective reactions without interfering with the amine functionality. The methyl group at the 1-position of the imidazole ring contributes to its steric properties and can influence its reactivity and solubility. The carboxylic acid functional group at the 2-position provides acidic characteristics, making it capable of participating in various chemical reactions, including esterification and amidation. This compound is typically utilized in the field of organic chemistry and biochemistry, particularly in the synthesis of peptides and other biologically relevant molecules. Its stability and reactivity profile make it a valuable intermediate in synthetic pathways.
Formula:C20H17N3O4
InChI:InChI=1/C20H17N3O4/c1-23-10-17(21-18(23)19(24)25)22-20(26)27-11-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)16/h2-10,16H,11H2,1H3,(H,22,26)(H,24,25)
- Synonyms:
- 4-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-1-methyl-1H-imidazole-2-carboxylic acid

4-(Fmoc-amino)-1-methyl-1H-imidazole-2-carboxylic Acid
Ref: 3B-F1313
1g | 115.00 € | ||
5g | 565.00 € |

4-(Fmoc-amino)-1-methyl-1H-imidazole-2-carboxylic acid
Ref: 01-4029141
1g | 1,421.00 € |

1H-Imidazole-2-carboxylic acid, 4-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-1-methyl-
Ref: IN-DA002QYD
1g | 605.00 € | ||
5g | To inquire | ||
25mg | 71.00 € | ||
100mg | 176.00 € | ||
250mg | 209.00 € |

4-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-1-methyl-1H-imidazole-2-carboxylic acid
Ref: 54-OR80879
1g | 336.00 € | ||
250mg | 209.00 € |

4-(FMOC-AMINO)-1-METHYL-1H-IMIDAZOLE-2-CARBOXYLIC ACID
Ref: 10-F303059
1g | 381.00 € | ||
100mg | 72.00 € | ||
250mg | 107.00 € |

4-(Fmoc-amino)-1-methyl-1H-imidazole-2-carboxylic acid
Ref: 3D-FF56100
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |