
CAS 25229-42-9
:3-Cyclohexyl-2-butenoic acid
Description:
3-Cyclohexyl-2-butenoic acid is an organic compound characterized by its unique structure, which includes a cyclohexyl group attached to a butenoic acid backbone. This compound features a double bond between the second and third carbon atoms of the butenoic acid chain, contributing to its unsaturated nature. The presence of the cyclohexyl group imparts hydrophobic characteristics, influencing its solubility and reactivity. Typically, compounds like 3-cyclohexyl-2-butenoic acid exhibit moderate to low solubility in water but may dissolve in organic solvents. The carboxylic acid functional group (-COOH) is responsible for its acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the compound may exhibit specific biological activities, making it of interest in medicinal chemistry and organic synthesis. Its structural features suggest potential applications in the development of pharmaceuticals or agrochemicals. As with many organic compounds, safety data should be consulted for handling and usage guidelines.
Formula:C10H16O2
InChI:InChI=1S/C10H16O2/c1-8(7-10(11)12)9-5-3-2-4-6-9/h7,9H,2-6H2,1H3,(H,11,12)
InChI key:InChIKey=WVRIPRILKKOIQL-UHFFFAOYSA-N
SMILES:C(=CC(O)=O)(C)C1CCCCC1
Synonyms:- Cicrotoic acid
- β-Methylcyclohexaneacrylic acid
- 2-Butenoic acid, 3-cyclohexyl-
- Cyclohexaneacrylic acid, β-methyl-
- 3-Cyclohexyl-2-butenoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Cicrotoic acid
CAS:<p>Cicrotoic acid, a biochemical drug, acts on bile flow and liquid composition of human bile.</p>Formula:C10H16O2Color and Shape:SolidMolecular weight:168.236Cicrotoic acid
CAS:<p>Cicrotoic acid is a synthetic, non-steroidal compound that has been shown to have functional group activating properties. Cicrotoic acid activates amines by reacting with the amino group, and can be used in the synthesis of amine-containing molecules. The molecule also reacts with fatty acids to form esters. This property may be useful for producing polymers with desirable properties such as occlusiveness. Cicrotoic acid has been shown to have a strong effect on humans, and has been studied for its use in nasal decongestants because of its ability to reduce swelling in the nose.</p>Formula:C10H16O2Purity:Min. 95%Molecular weight:168.23 g/mol

