CAS 2523-56-0: cis-4-Methylcyclohexanamine
Description:Cis-4-Methylcyclohexanamine, with the CAS number 2523-56-0, is an organic compound characterized by its cyclohexane ring structure with a methyl group and an amine functional group. This compound is a chiral amine, existing in a specific stereoisomeric form due to the arrangement of its substituents around the cyclohexane ring. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. The presence of the amine group imparts basic properties, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and condensation reactions. Additionally, cis-4-Methylcyclohexanamine is of interest in the synthesis of pharmaceuticals and agrochemicals, where it may serve as an intermediate or building block. Its physical properties, such as boiling point and solubility, can vary based on the specific conditions and purity of the sample. Safety data should be consulted for handling and storage, as amines can be hazardous.
Formula:C7H15N
InChI:InChI=1/C7H15N/c1-6-2-4-7(8)5-3-6/h6-7H,2-5,8H2,1H3/t6-,7+
InChI key:InChIKey=KSMVBYPXNKCPAJ-KNVOCYPGNA-N
SMILES:NC1CCC(C)CC1
- Synonyms:
- 4-cis-Methylcyclohexanamine
- 4-cis-Methylcyclohexylamine
- Cyclohexylamine, 4-methyl-, cis-
- Cyclohexylamine,4-methyl-, cis- (8CI)
- cis-1-Amino-4-methylcyclohexane
- cis-4-Methyl-1-cyclohexanamine
- cis-4-Methylcyclohexanamine
- cis-4-Methylcyclohexylamine
- Cyclohexanamine, 4-methyl-, cis-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | cis-4-Methylcyclohexylamine REF: 3B-M2949CAS: 2523-56-0 | >98.0%(T) | 196.00 € | Mon 07 Apr 25 |
![]() | cis-4-Methylcyclohexylamine. REF: IN-DA00C2YSCAS: 2523-56-0 | 98.0% | 288.00 €~517.00 € | Mon 14 Apr 25 |
![]() | cis-4-Methylcyclohexylamine REF: 3D-FM25810CAS: 2523-56-0 | Min. 95% | To inquire | Tue 27 May 25 |

cis-4-Methylcyclohexylamine
Ref: 3B-M2949
200mg | 196.00 € |

cis-4-Methylcyclohexylamine.
Ref: IN-DA00C2YS
200mg | 517.00 € |

cis-4-Methylcyclohexylamine
Ref: 3D-FM25810
50mg | 331.00 € | ||
100mg | 373.00 € | ||
250mg | 664.00 € | ||
500mg | 1,127.00 € |