CAS 25231-12-3
:Phenol, 3-chloro-, homopolymer
Description:
Phenol, 3-chloro-, homopolymer, identified by CAS number 25231-12-3, is a synthetic polymer derived from the polymerization of 3-chlorophenol monomers. This substance exhibits several notable characteristics. It is typically a solid at room temperature, with a high melting point and good thermal stability, making it suitable for various applications. The presence of chlorine in its structure contributes to its chemical reactivity and potential for further functionalization. This polymer is generally insoluble in water but may dissolve in organic solvents, which can be advantageous in certain industrial processes. Additionally, it possesses good mechanical strength and resistance to chemical degradation, making it useful in applications such as coatings, adhesives, and plastics. Safety considerations are important, as the monomer and polymer can be hazardous; therefore, appropriate handling and disposal measures should be observed. Overall, phenol, 3-chloro-, homopolymer is valued for its unique properties and versatility in various chemical and industrial applications.
Formula:(C6H5ClO)x
InChI:InChI=1S/C6H5ClO/c7-5-2-1-3-6(8)4-5/h1-4,8H
InChI key:InChIKey=HORNXRXVQWOLPJ-UHFFFAOYSA-N
SMILES:ClC1=CC(O)=CC=C1
Synonyms:- Phenol, m-chloro-, polymers
- m-Chlorophenol homopolymer
- Phenol, 3-chloro-, homopolymer
- 3-Chlorophenol homopolymer
- Poly(3-chlorophenol)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
