CAS 252333-72-5

4-[(5aR,6S,11aR)-1,5,5a,6,11,11a-Hexahydro-8-hydroxy-9-methoxy-3,3-dimethylnaphtho[2,3-e][1,3]dioxepin-6-yl]-1,2-benzenediol

Description:

The chemical substance known as "4-[(5aR,6S,11aR)-1,5,5a,6,11,11a-Hexahydro-8-hydroxy-9-methoxy-3,3-dimethylnaphtho[2,3-e][1,3]dioxepin-6-yl]-1,2-benzenediol" with CAS number 252333-72-5 is a complex organic compound characterized by its multi-ring structure and various functional groups. It features a naphtho[2,3-e][1,3]dioxepin core, which contributes to its unique chemical properties, including potential biological activity. The presence of hydroxyl (-OH) and methoxy (-OCH3) groups suggests that the compound may exhibit polar characteristics, influencing its solubility and reactivity. The stereochemistry indicated by the specific configuration at several chiral centers suggests that the compound may have distinct pharmacological properties, potentially making it of interest in medicinal chemistry. Its structural complexity may also imply interesting interactions with biological targets, warranting further investigation into its potential applications in pharmaceuticals or other fields. Overall, this compound exemplifies the intricate nature of organic molecules and their potential utility in various scientific domains.

Formula: C₂₂H₂₆O₆

InChI: InChI=1S/C22H26O6/c1-22(2)27-10-14-6-13-8-20(26-3)19(25)9-15(13)21(16(14)11-28-22)12-4-5-17(23)18(24)7-12/h4-5,7-9,14,16,21,23-25H,6,10-11H2,1-3H3/t14-,16-,21-/m0/s1

InChI key: InChIKey=GACLBPGDLVRRRN-HTZUNMPGSA-N

SMILES: OC=1C=C2[C@@H]([C@@]3([C@@](CC2=CC1OC)(COC(C)(C)OC3)[H])[H])C4=CC(O)=C(O)C=C4

Synonyms:

• 4-[(5aR,6S,11aR)-1,5,5a,6,11,11a-Hexahydro-8-hydroxy-9-methoxy-3,3-dimethylnaphtho[2,3-e][1,3]dioxepin-6-yl]-1,2-benzenediol
• 1,2-Benzenediol, 4-[(5aR,6S,11aR)-1,5,5a,6,11,11a-hexahydro-8-hydroxy-9-methoxy-3,3-dimethylnaphtho[2,3-e][1,3]dioxepin-6-yl]-

Isotaxiresinol 9,9'-acetonide

CAS: 252333-72-5

Formula: C₂₂H₂₆O₆

Purity: 96.0%

Molecular weight: 386.4382

Ref: IN-DA00C4SC

Isotaxiresinol 9,9'-acetonide

CAS: 252333-72-5

Isotaxiresinol 9,9'-acetonide is a natural product for research related to life sciences. The catalog number is TN4333 and the CAS number is 252333-72-5.

Formula: C₂₂H₂₆O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 386.44

Ref: TM-TN4333

Isotaxiresinol 9,9'-acetonide

CAS: 252333-72-5

Formula: C₂₂H₂₆O₆

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 386.444

Ref: BP-SBP02393

Isotaxiresinol 9,9'-acetonide

CAS: 252333-72-5

Isotaxiresinol 9,9'-acetonide is a synthetic derivative of lignans, which are a type of polyphenolic compound. This compound is sourced mainly from plant materials, where lignans occur naturally in high concentrations. Lignans are well-known for their role in plant defense and have drawn attention for their bioactive properties.

Formula: C₂₂H₂₆O₆

Purity: Min. 95%

Molecular weight: 386.4 g/mol

Ref: 3D-CKA33372