CAS 25234-25-7

2-Ethyloctanoic acid

Description:

2-Ethyloctanoic acid, with the CAS number 25234-25-7, is a branched-chain fatty acid characterized by its eight-carbon chain and an ethyl group attached to the second carbon. This compound is typically a colorless to pale yellow liquid with a distinctive fatty odor. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The presence of the carboxylic acid functional group (-COOH) imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and neutralization. 2-Ethyloctanoic acid is often used in the synthesis of surfactants, lubricants, and as a plasticizer in polymer production. Additionally, it can serve as an intermediate in the production of other chemical compounds. Its branched structure contributes to its unique physical and chemical properties, making it valuable in industrial applications. Safety data indicates that, while it may cause irritation upon contact with skin or eyes, it is generally considered to have low toxicity when handled properly.

Formula: C₁₀H₂₀O₂

InChI: InChI=1S/C10H20O2/c1-3-5-6-7-8-9(4-2)10(11)12/h9H,3-8H2,1-2H3,(H,11,12)

InChI key: InChIKey=DMUXSGAKEXSNGN-UHFFFAOYSA-N

SMILES: C(CCCCCC)(C(O)=O)CC

Synonyms:

• Caprylic acid, α-ethyl-
• Octanoic acid, 2-ethyl-
• α-Ethylcaprylic acid
• 2-Ethyloctanoic acid

Octanoic acid, 2-ethyl-

CAS: 25234-25-7

Formula: C₁₀H₂₀O₂

Purity: 95%

Molecular weight: 172.2646

Ref: IN-DA007O0T

2-Ethyloctanoic acid

CAS: 25234-25-7

2-Ethyloctanoic acid is a raw material for the production of dyes and can be used as a stabilizer and catalyst in the production of coatings.

Formula: C₁₀H₂₀O₂

Purity: ≥98%

Color and Shape: Solid

Molecular weight: 172.26

Ref: TM-T84058

2-Ethyloctanoic acid

CAS: 25234-25-7

2-Ethyloctanoic acid

Purity: ≥98%

Molecular weight: 172.26g/mol

Ref: 54-BUP11347

2-Ethyloctanoic acid

CAS: 25234-25-7

2-Ethyloctanoic acid is an industrial chemical used in the process of making polymers. It is a low temperature, processable chemical that has been shown to form nanoparticles at room temperature. 2-Ethyloctanoic acid can be used as a raw material for the production of polymeric materials and coatings with optical, metallic, and transition properties. This compound has been shown to have a high transmittance (80%) and low exothermic values (less than 0.5 J/g).

Formula: C₁₀H₂₀O₂

Purity: Min. 95%

Molecular weight: 172.26 g/mol

Ref: 3D-ABA23425