CAS 252348-76-8

methyl 2-[(tert-butoxycarbonylamino)methyl]-1H-imidazole-4-carboxylate

Description:

Methyl 2-[(tert-butoxycarbonylamino)methyl]-1H-imidazole-4-carboxylate is a chemical compound characterized by its imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features a carboxylate group, which contributes to its acidic properties, and a tert-butoxycarbonyl (Boc) protecting group that is commonly used in organic synthesis to protect amines during reactions. The presence of the methyl ester indicates that it can undergo hydrolysis to yield the corresponding carboxylic acid. The structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the imidazole moiety's biological activity. Additionally, the compound's solubility and reactivity can be influenced by the functional groups present, making it a versatile intermediate in synthetic pathways. Overall, this compound exemplifies the complexity and utility of organic molecules in chemical research and development.

Formula: C₁₁H₁₇N₃O₄

InChI: InChI=1/C11H17N3O4/c1-11(2,3)18-10(16)13-6-8-12-5-7(14-8)9(15)17-4/h5H,6H2,1-4H3,(H,12,14)(H,13,16)

SMILES: CC(C)(C)OC(=NCc1ncc(C(=O)OC)[nH]1)O

Methyl 2-(aminomethyl)-1H-imidazole-4-carboxylate, 2-BOC protected

CAS: 252348-76-8

Methyl 2-(aminomethyl)-1H-imidazole-4-carboxylate, 2-BOC protected

Purity: ≥95%

Molecular weight: 255.27g/mol

Ref: 54-OR30641