CAS 252351-95-4

Lucidadiol

Description:

Lucidadiol, with the CAS number 252351-95-4, is a chemical compound that belongs to the class of natural products known as terpenoids. It is characterized by its unique molecular structure, which typically includes multiple rings and functional groups that contribute to its biological activity. Lucidadiol is primarily derived from certain plant sources and has been studied for its potential pharmacological properties, including anti-inflammatory and antioxidant effects. Its solubility characteristics may vary depending on the solvent used, and it is often analyzed using techniques such as chromatography and spectroscopy to determine its purity and concentration. The compound's stability and reactivity can be influenced by environmental factors such as temperature and pH. While specific applications in pharmaceuticals or other industries may be under investigation, further research is necessary to fully elucidate its mechanisms of action and potential therapeutic uses. As with many chemical substances, safety data and handling precautions should be observed when working with Lucidadiol in laboratory settings.

Formula: C₃₀H₄₈O₃

InChI: InChI=1S/C30H48O3/c1-19(18-31)9-8-10-20(2)21-11-16-30(7)26-22(12-15-29(21,30)6)28(5)14-13-25(33)27(3,4)24(28)17-23(26)32/h9,20-21,24-25,31,33H,8,10-18H2,1-7H3/b19-9+/t20-,21-,24+,25+,28-,29-,30+/m1/s1

InChI key: InChIKey=AZPOACUDFJKUHJ-GPEQXWBKSA-N

SMILES: C[C@]12C3=C([C@]4(C)[C@@](CC3=O)(C(C)(C)[C@@H](O)CC4)[H])CC[C@]1(C)[C@@]([C@@H](CC/C=C(/CO)\C)C)(CC2)[H]

Synonyms:

• Ganoderon B
• 3,26-Dihydroxylanosta-8,24-dien-7-one
• Lucidadiol
• Lanosta-8,24-dien-7-one, 3,26-dihydroxy-, (3β,24E)-
• (3β,24E)-3,26-Dihydroxylanosta-8,24-dien-7-one

Lucidadiol

CAS: 252351-95-4

Lucidadiol inhibits butyrylcholinesterase and AChE, effective up to 200 uM; fights influenza A and HSV-1.

Formula: C₃₀H₄₈O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 456.7

Ref: TM-TN4456

Lucidadiol

CAS: 252351-95-4

Formula: C₃₀H₄₈O₃

Purity: 95%~99%

Molecular weight: 456.711

Ref: BP-SBP03738

Lucidadiol

Controlled Product

CAS: 252351-95-4

Lucidadiol is a synthetic small molecule compound, which is derived from a laboratory-engineered chemical synthesis. This synthesis involves strategic modification of precursor molecules to enhance efficacy and stability. Lucidadiol functions primarily through modulation of cellular signaling pathways, specifically targeting molecular interactions that regulate key physiological processes. By altering these interactions, it effectively modifies cell behavior to achieve desired therapeutic outcomes.

Formula: C₃₀H₄₈O₃

Purity: Min. 95%

Molecular weight: 456.7 g/mol

Ref: 3D-CKA35195