CAS 25236-64-0: Ethanol, 2,2,2-trifluoro-, 1-methanesulfonate
Description:Ethanol, 2,2,2-trifluoro-, 1-methanesulfonate, with the CAS number 25236-64-0, is an organofluorine compound characterized by the presence of a trifluoromethyl group and a methanesulfonate moiety. This compound typically appears as a colorless liquid and is known for its high reactivity due to the presence of the sulfonate group, which can act as a leaving group in various chemical reactions. The trifluoromethyl group imparts unique electronic properties, enhancing the compound's stability and lipophilicity, making it useful in organic synthesis and medicinal chemistry. Ethanol derivatives often exhibit polar characteristics due to the hydroxyl group, which can influence solubility in polar solvents. Additionally, the trifluoromethyl group can enhance the compound's biological activity and pharmacokinetic properties. Safety data indicates that, like many organofluorine compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, this compound serves as a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals.
Formula:C3H5F3O3S
InChI:InChI=1S/C3H5F3O3S/c1-10(7,8)9-2-3(4,5)6/h2H2,1H3
InChI key:InChIKey=ICECLJDLAVVEOW-UHFFFAOYSA-N
SMILES:O=S(=O)(OCC(F)(F)F)C
- Synonyms:
- 2,2,2-Trifluoroethyl methanesulfonate
- 2,2,2-Trifluoroethyl mesylate
- Ethanol, 2,2,2-trifluoro-, 1-methanesulfonate
- Ethanol, 2,2,2-trifluoro-, methanesulfonate
- 2,2,2-Trifluoroethyl methylsulfonate

2,2,2-Trifluoroethyl Methanesulfonate
Ref: 3B-M1193
5g | 35.00 € | ||
25g | 84.00 € |

2,2,2-TRIFLUOROETHYL METHANESULFONATE
Ref: IN-DA003F77
1g | 29.00 € | ||
5g | 47.00 € | ||
25g | 123.00 € | ||
100g | 463.00 € | ||
250mg | 24.00 € |

2,2,2-Trifluoroethyl methanesulphonate
Ref: 54-PC3889
1g | 76.00 € | ||
5g | 93.00 € | ||
25g | 191.00 € |

Methanesulfonic acid 2,2,2-trifluoroethyl ester
Ref: 10-F008580
5g | 36.00 € | ||
25g | 48.00 € | ||
100g | 162.00 € |

2,2,2-Trifluoroethyl Methanesulfonate
Ref: 3D-FT60415
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information | |
100g | Discontinued | Request information |