CAS 25236-64-0
:Ethanol, 2,2,2-trifluoro-, 1-methanesulfonate
Description:
Ethanol, 2,2,2-trifluoro-, 1-methanesulfonate, with the CAS number 25236-64-0, is an organofluorine compound characterized by the presence of a trifluoromethyl group and a methanesulfonate moiety. This compound typically appears as a colorless liquid and is known for its high reactivity due to the presence of the sulfonate group, which can act as a leaving group in various chemical reactions. The trifluoromethyl group imparts unique electronic properties, enhancing the compound's stability and lipophilicity, making it useful in organic synthesis and medicinal chemistry. Ethanol derivatives often exhibit polar characteristics due to the hydroxyl group, which can influence solubility in polar solvents. Additionally, the trifluoromethyl group can enhance the compound's biological activity and pharmacokinetic properties. Safety data indicates that, like many organofluorine compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, this compound serves as a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals.
Formula:C3H5F3O3S
InChI:InChI=1S/C3H5F3O3S/c1-10(7,8)9-2-3(4,5)6/h2H2,1H3
InChI key:InChIKey=ICECLJDLAVVEOW-UHFFFAOYSA-N
SMILES:C(OS(C)(=O)=O)C(F)(F)F
Synonyms:- 2,2,2-Trifluoroethyl methanesulfonate
- 2,2,2-Trifluoroethyl mesylate
- Ethanol, 2,2,2-trifluoro-, 1-methanesulfonate
- Ethanol, 2,2,2-trifluoro-, methanesulfonate
- 2,2,2-Trifluoroethyl methylsulfonate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,2,2-Trifluoroethyl Methanesulfonate
CAS:Formula:C3H5F3O3SPurity:>98.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:178.13Ethanol, 2,2,2-trifluoro-, 1-methanesulfonate
CAS:Formula:C3H5F3O3SPurity:97%Color and Shape:LiquidMolecular weight:178.13022,2,2-Trifluoroethyl methanesulphonate
CAS:<p>2,2,2-Trifluoroethyl methanesulphonate</p>Formula:C3H5F3O3SPurity:98%Color and Shape: clear liquidMolecular weight:178.13g/molMethanesulfonic acid 2,2,2-trifluoroethyl ester
CAS:Formula:C3H5F3O3SPurity:97%Color and Shape:LiquidMolecular weight:178.132,2,2-Trifluoroethyl Methanesulfonate
CAS:<p>Trifluromethanesulfonic acid, also known as trifluoroacetic acid or TFA, is a colorless liquid that is miscible in water. Trifluromethanesulfonic acid has been shown to induce apoptosis in cancer cells by inhibiting the histone deacetylase (HDAC) enzyme. It also inhibits the PI3Kδ enzyme and has been shown to be an inhibitor of cancer cell growth. Trifluromethanesulfonic acid is a reactive compound with acidic properties and can react with other compounds to form salts, such as sodium trifluoromethanesulfonate. The fluorine atom in trifluromethanesulfonic acid can be substituted with chlorine atoms. Substituent effects on the chemical structure are also important for its activity.End></p>Formula:C3H5F3O3SPurity:Min. 95%Molecular weight:178.13 g/mol




