CAS 25237-06-3

1,1,2,3,4,4-hexachlorobutane

Description:

1,1,2,3,4,4-Hexachlorobutane is a synthetic organic compound characterized by the presence of six chlorine atoms attached to a butane backbone. Its molecular formula is C4H2Cl6, indicating a high degree of chlorination, which significantly influences its chemical properties and behavior. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It is known for its stability and resistance to degradation, making it persistent in the environment. 1,1,2,3,4,4-Hexachlorobutane is primarily used in industrial applications, including as an intermediate in the synthesis of other chemicals and as a potential pesticide. However, due to its chlorinated nature, it raises environmental and health concerns, particularly regarding its toxicity and potential for bioaccumulation. Regulatory agencies often monitor such compounds for their ecological impact and potential risks to human health, emphasizing the importance of handling them with care in controlled environments.

Formula: C₄H₄Cl₆

InChI: InChI=1/C4H4Cl6/c5-1(3(7)8)2(6)4(9)10/h1-4H

Synonyms:

• 1,1,2,3,4,4-Hexachlorobutane
• butane, 1,1,2,3,4,4-hexachloro-

1,1,2,3,4,4-Hexachlorobutane

CAS: 25237-06-3

Formula: C₄H₄Cl₆

Molecular weight: 264.78

Ref: 4Z-B-150034