CAS 2524-37-0
:ethyl 2,4-dihydroxy-6-methylbenzoate
Description:
Ethyl 2,4-dihydroxy-6-methylbenzoate, with the CAS number 2524-37-0, is an organic compound that belongs to the class of benzoate esters. It features a benzoic acid derivative with two hydroxyl groups at the 2 and 4 positions and a methyl group at the 6 position of the aromatic ring. The ethyl ester group contributes to its solubility in organic solvents. This compound is typically characterized by its moderate polarity, which allows it to interact with both polar and nonpolar environments. It may exhibit biological activity, making it of interest in pharmaceutical and agricultural applications. The presence of hydroxyl groups suggests potential for hydrogen bonding, influencing its physical properties such as melting and boiling points, as well as its reactivity. Ethyl 2,4-dihydroxy-6-methylbenzoate may also be involved in various chemical reactions, including esterification and substitution reactions, due to the functional groups present. Overall, its unique structure contributes to its potential utility in various chemical and industrial applications.
Formula:C10H12O4
InChI:InChI=1S/C10H12O4/c1-3-14-10(13)9-6(2)4-7(11)5-8(9)12/h4-5,11-12H,3H2,1-2H3
InChI key:InChIKey=UQSRXQMIXSZGLA-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(C)C=C(O)C=C1O
Synonyms:- 2,4-Dihydroxy-6-methylbenzoic acid ethyl ester
- Benzoic acid, 2,4-dihydroxy-6-methyl-, ethyl ester
- Ethyl orsellinate
- NSC 149781
- β-Resorcylic acid, 6-methyl-, ethyl ester
- Ethyl 2,4-dihydroxy-6-methylbenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Ethyl 2,4-Dihydroxy-6-methylbenzoate
CAS:Formula:C10H12O4Purity:>98.0%(T)Color and Shape:White to Gray to Brown powder to crystalMolecular weight:196.20Ethyl 2,4-dihydroxy-6-methylbenzoate
CAS:Formula:C10H12O4Purity:98%Color and Shape:SolidMolecular weight:196.1999Ethyl Orsellinate
CAS:Ethyl Orsellinate (Orsellinic acid ethyl ester) is a phenolic acid, extracted from lichens.Formula:C10H12O4Purity:97.53%Color and Shape:SolidMolecular weight:196.2Ethyl 2,4-dihydroxy-6-methylbenzoate
CAS:Ethyl 2,4-dihydroxy-6-methylbenzoatePurity:97%Color and Shape:SolidMolecular weight:196.20g/molEthyl 2,4-dihydroxy-6-methylbenzoate
CAS:<p>Ethyl 2,4-dihydroxy-6-methylbenzoate is a phenolic acid that is found in lichens. It has been shown to have anti-cancer and anti-inflammatory properties. The hydrogen bonds of ethyl 2,4-dihydroxy-6-methylbenzoate are the result of an intramolecular hydrogen bonding between the benzoic acid group and the hydroxymethyl group. This compound can also be found in matrix effect health care products as well as wastewater treatment plants. Ethyl 2,4-dihydroxy-6-methylbenzoate has also been shown to inhibit enzymes such as uv absorption and phenolic acids.</p>Formula:C10H12O4Purity:Min. 95%Molecular weight:196.2 g/molEthyl 2,4-Dihydroxy-6-methylbenzoate
CAS:Formula:C10H12O4Purity:97.0%Color and Shape:Off-white powderMolecular weight:196.202






