CAS 25245-29-8
:5-Iodo-1,2,3-trimethoxybenzene
Description:
5-Iodo-1,2,3-trimethoxybenzene is an organic compound characterized by the presence of an iodine atom and three methoxy groups attached to a benzene ring. The methoxy groups (-OCH3) are electron-donating substituents that can influence the compound's reactivity and solubility. The iodine atom, being a halogen, introduces unique properties such as increased molecular weight and potential for electrophilic substitution reactions. This compound is typically a solid at room temperature and may exhibit moderate to low solubility in polar solvents due to the hydrophobic nature of the benzene ring and the methoxy groups. Its structure suggests potential applications in organic synthesis, medicinal chemistry, and materials science, particularly in the development of pharmaceuticals or as intermediates in chemical reactions. Additionally, the presence of iodine may impart interesting biological activities, making it a subject of interest in research related to drug development. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks.
Formula:C9H11IO3
InChI:InChI=1/C9H11IO3/c1-11-7-4-6(10)5-8(12-2)9(7)13-3/h4-5H,1-3H3
SMILES:COc1cc(cc(c1OC)OC)I
Synonyms:- 3,4,5-Trimethoxyiodobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Iodo-1,2,3-trimethoxybenzene, 97%
CAS:5-Iodo-1,2,3-trimethoxybenzene is used as a primary and secondary intermediate in organic synthesis. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa AesarFormula:C9H11IO3Purity:97%Color and Shape:Yellow to pale brown, Crystals or powder or crystalline powder or granulesMolecular weight:294.095-Iodo-1,2,3-trimethoxybenzene
CAS:Formula:C9H11IO3Purity:98%Color and Shape:SolidMolecular weight:294.08635-Iodo-1,2,3-trimethoxybenzene
CAS:5-Iodo-1,2,3-trimethoxybenzeneFormula:C9H11IO3Purity:≥95%Color and Shape: faint to light yellow crystalline solidMolecular weight:294.09g/mol5-IODO-1,2,3-TRIMETHOXYBENZENE
CAS:Formula:C9H11IO3Purity:98%Color and Shape:Liquid, No data available.Molecular weight:294.088



