CAS 25246-27-9
:1,1,7-trimethyl-4-methylidenedecahydro-1H-cyclopropa[e]azulene
Description:
1,1,7-Trimethyl-4-methylidenedecahydro-1H-cyclopropa[e]azulene, with the CAS number 25246-27-9, is a complex organic compound characterized by its unique polycyclic structure. This substance belongs to the class of azulenes, which are known for their distinctive blue color and aromatic properties. The presence of multiple methyl groups in its structure contributes to its hydrophobic nature and influences its reactivity and stability. The compound features a cyclopropane ring fused with a decahydro framework, which can impart strain and affect its chemical behavior. Typically, compounds of this nature may exhibit interesting physical properties, such as volatility and solubility in organic solvents. Additionally, the structural complexity may lead to unique interactions in biological systems, although specific biological activity would require further investigation. Overall, 1,1,7-trimethyl-4-methylidenedecahydro-1H-cyclopropa[e]azulene represents a fascinating subject for study in organic chemistry and materials science due to its intricate structure and potential applications.
Formula:C15H24
InChI:InChI=1/C15H24/c1-9-6-8-12-14(15(12,3)4)13-10(2)5-7-11(9)13/h10-14H,1,5-8H2,2-4H3
SMILES:C=C1CCC2C(C3C(C)CCC13)C2(C)C
Synonyms:- 1,1,7-Trimethyl-4-methylenedecahydro-1H-cyclopropa[e]azulene
- 1H-Cycloprop[e]azulene, decahydro-1,1,7-trimethyl-4-methylene-
- (-)-Alloaromadendrene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
