CymitQuimica logo

CAS 25252-47-5

:

1-methyl-3-phenyl-1H-thieno[2,3-c]pyrazole-5-carboxylic acid

Description:
1-Methyl-3-phenyl-1H-thieno[2,3-c]pyrazole-5-carboxylic acid is a heterocyclic organic compound characterized by its unique thieno-pyrazole structure, which incorporates both sulfur and nitrogen atoms in its ring system. This compound features a methyl group and a phenyl group, contributing to its aromatic properties and potential biological activity. The carboxylic acid functional group enhances its solubility in polar solvents and may influence its reactivity and interaction with biological targets. The thieno[2,3-c]pyrazole framework is of interest in medicinal chemistry due to its potential applications in drug development, particularly in areas such as anti-inflammatory and analgesic agents. The compound's molecular structure allows for various substitution patterns, which can be explored to optimize its pharmacological properties. Additionally, the presence of the carboxylic acid group may facilitate hydrogen bonding, impacting its binding affinity to biological macromolecules. Overall, this compound exemplifies the complexity and diversity of heterocyclic chemistry, with implications for both synthetic and medicinal applications.
Formula:C13H10N2O2S
InChI:InChI=1/C13H10N2O2S/c1-15-12-9(7-10(18-12)13(16)17)11(14-15)8-5-3-2-4-6-8/h2-7H,1H3,(H,16,17)
InChI key:BVZJRZIDTOEFJF-UHFFFAOYSA-N
SMILES:Cn1c2c(cc(C(=O)O)s2)c(c2ccccc2)n1
Synonyms:
  • 1H-thieno[2,3-c]pyrazole-5-carboxylic acid, 1-methyl-3-phenyl-
  • 1-Methyl-3-phenyl-1H-thieno[2,3-c]pyrazole-5-carboxylic acid
Found 2 products.