CAS 252562-09-7

4-Amino-2-methoxybenzenesulfonamide

Description:

4-Amino-2-methoxybenzenesulfonamide, with the CAS number 252562-09-7, is an organic compound characterized by the presence of an amino group, a methoxy group, and a sulfonamide functional group attached to a benzene ring. This compound typically appears as a solid and is soluble in polar solvents due to the presence of the sulfonamide group, which enhances its hydrophilicity. The amino group contributes to its basicity, while the methoxy group can influence its electronic properties and reactivity. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting various diseases. Its structural features suggest potential interactions with biological molecules, which could be explored in medicinal chemistry. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices. Overall, 4-Amino-2-methoxybenzenesulfonamide represents a versatile compound with potential applications in both research and industry.

Formula: C₇H₁₀N₂O₃S

InChI: InChI=1S/C7H10N2O3S/c1-12-6-4-5(8)2-3-7(6)13(9,10)11/h2-4H,8H2,1H3,(H2,9,10,11)

InChI key: InChIKey=HOMJNVKDXFQPMZ-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C1=C(OC)C=C(N)C=C1

Synonyms:

• Benzenesulfonamide, 4-amino-2-methoxy-
• 4-Amino-2-methoxybenzenesulfonamide

4-Amino-2-methoxybenzene-1-sulfonamide

CAS: 252562-09-7

Versatile small molecule scaffold

Formula: C₇H₁₀N₂O₃S

Purity: Min. 95%

Molecular weight: 202.23 g/mol

Ref: 3D-CKA56209