CAS 25263-44-9
:(3-hydroxyphenyl)acetonitrile
Description:
(3-Hydroxyphenyl)acetonitrile, with the CAS number 25263-44-9, is an organic compound characterized by the presence of a hydroxyl group (-OH) attached to a phenyl ring, which is further connected to an acetonitrile group (-C≡N). This compound typically appears as a solid or liquid, depending on its purity and environmental conditions. It is known for its role in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The hydroxyl group contributes to its polarity, enhancing its solubility in polar solvents, while the nitrile group can participate in various chemical reactions, such as nucleophilic additions. Additionally, (3-hydroxyphenyl)acetonitrile may exhibit biological activity, making it of interest in medicinal chemistry. Safety data indicates that, like many nitriles, it should be handled with care due to potential toxicity and irritant properties. Overall, this compound serves as a valuable building block in chemical research and industrial applications.
Formula:C8H7NO
InChI:InChI=1/C8H7NO/c9-5-4-7-2-1-3-8(10)6-7/h1-3,6,10H,4H2
SMILES:c1cc(CC#N)cc(c1)O
Synonyms:- Benzeneacetonitrile, 3-Hydroxy-
- m-Hydroxy benzyl cyanide
- (3-Hydroxyphenyl)acetonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Hydroxyphenylacetonitrile
CAS:Formula:C8H7NOPurity:98%Color and Shape:SolidMolecular weight:133.1473(3-Hydroxyphenyl)acetonitrile
CAS:(3-Hydroxyphenyl)acetonitrilePurity:98%Molecular weight:133.15g/mol(3-Hydroxyphenyl)acetonitrile
CAS:Formula:C8H7NOPurity:>95.0%(GC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:133.153-Hydroxyphenylacetonitrile
CAS:<p>3-Hydroxyphenylacetonitrile is a molecule that is the precursor for a number of isothiocyanates, which are phytochemicals with antibacterial properties. It has been shown to have inhibitory effects on dopamine hydroxylase, an enzyme that catalyzes the conversion of dopamine to norepinephrine and epinephrine. 3-Hydroxyphenylacetonitrile also inhibits the activity of other active enzymes such as cytochrome P450. The inhibition of these enzymes by 3-hydroxyphenylacetonitrile may be responsible for its antibacterial properties. This molecule is inactivated by cyanides, which leads to its inability to produce any isothiocyanates. Kinetic studies show that 3-hydroxyphenylacetonitrile saturates at high concentrations, leading to decreased production of cyanide.</p>Formula:C8H7NOPurity:Min. 95%Color and Shape:PowderMolecular weight:133.15 g/mol
