CAS 252670-82-9

4-Pyridineethanesulfonyl chloride

Description:

4-Pyridineethanesulfonyl chloride, with the CAS number 252670-82-9, is a chemical compound characterized by its sulfonyl chloride functional group attached to a pyridine ring. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity, particularly in nucleophilic substitution reactions. It serves as a versatile reagent in organic synthesis, often used for the introduction of sulfonyl groups into various substrates, which can enhance their reactivity or solubility. The presence of the pyridine moiety contributes to its ability to participate in diverse chemical reactions, including acylation and sulfonation. Additionally, 4-Pyridineethanesulfonyl chloride is sensitive to moisture and should be handled under anhydrous conditions to prevent hydrolysis, which can lead to the formation of less reactive sulfonic acids. Safety precautions are essential when working with this compound, as it can be corrosive and irritating to the skin, eyes, and respiratory system. Proper storage and handling protocols are crucial to ensure safe usage in laboratory settings.

Formula: C₇H₈ClNO₂S

InChI: InChI=1S/C7H8ClNO2S/c8-12(10,11)6-3-7-1-4-9-5-2-7/h1-2,4-5H,3,6H2

InChI key: InChIKey=WHXRBCKHWPNHMP-UHFFFAOYSA-N

SMILES: C(CS(Cl)(=O)=O)C=1C=CN=CC1

Synonyms:

• 2-(Pyridin-4-Yl)Ethanesulfonyl Chloride
• 2-(Pyridin-4-yl)ethane-1-sulfonyl chloride
• 2-Pyridin-4-Ylethanesulfonyl Chloride
• 4-Pyridineethanesulfonyl chloride

2-(Pyridin-4-yl)ethane-1-sulphonyl chloride

CAS: 252670-82-9

2-(Pyridin-4-yl)ethane-1-sulphonyl chloride

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 205.66g/mol

Ref: 54-OR400473