CAS 25271-35-6
:1-Methylpiperidine-2-carboxylic acid hydrochloride
Description:
1-Methylpiperidine-2-carboxylic acid hydrochloride is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a methyl group at the 1-position and a carboxylic acid functional group at the 2-position of the piperidine ring, contributing to its acidic properties. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications in organic synthesis and pharmaceutical research. Typically, this compound exhibits properties such as being a white crystalline solid, with a specific melting point range and solubility in polar solvents. Its structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry. Additionally, the presence of the carboxylic acid group can facilitate hydrogen bonding, influencing its reactivity and interactions with other molecules. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C7H14ClNO2
InChI:InChI=1/C7H13NO2.ClH/c1-8-5-3-2-4-6(8)7(9)10;/h6H,2-5H2,1H3,(H,9,10);1H
SMILES:CN1CCCCC1C(=O)O.Cl
Synonyms:- 1-Methyl-2-piperidinecarboxylic acid hydrochloride
- 2-Piperidinecarboxylic Acid, 1-Methyl- Hydrochloride
- 2-Piperidinecarboxylic acid, N-methyl- hydrochloride
- N-Methyl-2-piperidinecarboxylic acid hydrochloride
- N-Methylpiperidine-2-carboxylic acid hydrochloride
- T6Ntj A1 Bvq
- 1-Methyl-Piperidine-2-Carboxylic Acid Hcl
- 2-Carboxy-1-Methyl-Piperidine Hcl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Methylpiperidine-2-carboxylic acid, HCl
CAS:Formula:C7H14ClNO2Purity:95%Color and Shape:SolidMolecular weight:179.64461-Methylpiperidine-2-carboxylic acid hydrochloride
CAS:<p>1-Methylpiperidine-2-carboxylic acid hydrochloride</p>Formula:C7H13NO2·ClHPurity:98%Color and Shape: off-white crystalline solidMolecular weight:179.64g/mol1-Methylpiperidine-2-carboxylic acid hydrochloride
CAS:Formula:C7H14ClNO2Purity:95%;RGColor and Shape:Solid, CrystallineMolecular weight:179.641-Methylpiperidine-2-Carboxylic Acid Hydrochloride
CAS:<p>Versatile small molecule scaffold</p>Formula:C7H14ClNO2Purity:Min. 95%Molecular weight:179.64 g/mol



