CAS 25278-95-9
:Meliantriol
Description:
Meliantriol, with the CAS number 25278-95-9, is a chemical compound that belongs to the class of triterpenoids, specifically derived from the plant Melia azedarach, commonly known as the chinaberry tree. This compound is characterized by its unique molecular structure, which includes multiple hydroxyl groups, contributing to its potential biological activities. Meliantriol has been studied for its various pharmacological properties, including anti-inflammatory, antioxidant, and potential anticancer effects. It exhibits solubility in organic solvents, which is typical for many triterpenoids, while its solubility in water is limited. The compound's biological activity is attributed to its ability to interact with cellular pathways, making it a subject of interest in medicinal chemistry and natural product research. Additionally, Meliantriol's safety profile and toxicity are important considerations in its application, necessitating further research to fully understand its therapeutic potential and mechanisms of action.
Formula:C30H50O5
InChI:InChI=1S/C30H50O5/c1-26(2)22-9-8-20-19(28(22,5)13-12-23(26)31)11-15-29(6)18(10-14-30(20,29)7)17-16-21(35-25(17)33)24(32)27(3,4)34/h8,17-19,21-25,31-34H,9-16H2,1-7H3/t17-,18-,19-,21+,22-,23-,24-,25+,28+,29-,30+/m0/s1
InChI key:InChIKey=IKJQENAHDRKFKL-JJDPDEBESA-N
SMILES:C[C@@]12C=3[C@@]([C@]4(C)[C@@](CC3)(C(C)(C)[C@@H](O)CC4)[H])(CC[C@@]1(C)[C@@](CC2)([C@@]5(C[C@]([C@@H](C(C)(C)O)O)(O[C@H]5O)[H])[H])[H])[H]
Synonyms:- 17βH-Lanost-7-ene-3β,21,24,25-tetrol, 21,23-epoxy-
- Lanost-7-ene-3,21,24,25-tetrol, 21,23-epoxy-, (3β,13α,14β,17α,20S,21R,23R,24S)-
- (3β,13α,14β,17α,20S,21R,23R,24S)-21,23-Epoxylanost-7-ene-3,21,24,25-tetrol
- Meliantriol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Meliantriol
CAS:Meliantriol from Neem binds to PBP2A & PVL toxins; energies -6.02 & -8.94 kcal/mol.
Formula:C30H50O5Color and Shape:SolidMolecular weight:490.71
