CAS 2528-00-9

5-Chloromethyl-2-furoic acid ethyl ester

Description:

5-Chloromethyl-2-furoic acid ethyl ester is an organic compound characterized by its furoic acid structure, which features a furan ring substituted with a chloromethyl group and an ethyl ester functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its reactivity, particularly in organic synthesis, where it can participate in various chemical reactions such as esterification and nucleophilic substitution due to the presence of the chloromethyl group. The ethyl ester moiety enhances its solubility in organic solvents, making it useful in various applications, including pharmaceuticals and agrochemicals. Additionally, the presence of the chlorine atom can impart unique properties, such as increased lipophilicity and potential biological activity. Safety considerations should be taken into account when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate safety measures should be implemented in laboratory settings.

Formula: C₈H₉ClO₃

InChI: InChI=1/C8H9ClO3/c1-2-11-8(10)7-4-3-6(5-9)12-7/h3-4H,2,5H2,1H3

SMILES: CCOC(=O)c1ccc(CCl)o1

Synonyms:

• Vinyl Caprate = Vinyl Decanoate
• 5-Chloromethyl-2-furancarboxylic acid ethyl ester
• Ethyl 5-(chloromethyl)-2-furoate
• Ethyl 5-(Chloromethyl)Furan-2-Carboxylate
• Ethyl 5-(Chloromethyl)-2-Furancarboxylate

Ethyl 5-(chloromethyl)furan-2-carboxylate

CAS: 2528-00-9

Formula: C₈H₉ClO₃

Purity: 98%

Color and Shape: Liquid

Molecular weight: 188.6083

Ref: IN-DA003QBU

Ethyl 5-(chloromethyl)-2-furoate

CAS: 2528-00-9

Ethyl 5-(chloromethyl)-2-furoate

Purity: 97%

Molecular weight: 188.61g/mol

Ref: 54-OR0104

Ethyl 5-chloromethyl-2-furoate

CAS: 2528-00-9

Formula: C₈H₉ClO₃

Purity: 97%

Color and Shape: Liquid, Clear

Molecular weight: 188.61

Ref: 10-F010659