CAS 252854-34-5

4-Ethyl-N-methylcyclohexanamine

Description:

4-Ethyl-N-methylcyclohexanamine, with the CAS number 252854-34-5, is an organic compound characterized by its cyclohexane structure substituted with an ethyl group and a methylamino group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is known for its potential applications in various fields, including pharmaceuticals and chemical synthesis. The presence of the amine functional group suggests that it may exhibit basic properties and can participate in hydrogen bonding, influencing its solubility in polar solvents. Additionally, the ethyl and methyl substituents can affect the compound's steric hindrance and reactivity, making it of interest in medicinal chemistry for the development of new therapeutic agents. Safety data should be consulted for handling and storage, as amines can be reactive and may pose health risks. Overall, 4-Ethyl-N-methylcyclohexanamine is a compound of interest due to its unique structural features and potential utility in various chemical applications.

Formula: C₉H₁₉N

InChI: InChI=1S/C9H19N/c1-3-8-4-6-9(10-2)7-5-8/h8-10H,3-7H2,1-2H3

InChI key: InChIKey=QMMUYVTYTBICLS-UHFFFAOYSA-N

SMILES: C(C)C1CCC(NC)CC1

Synonyms:

• 4-Ethyl-N-methylcyclohexanamine
• Cyclohexanamine, 4-ethyl-N-methyl-

4-Ethyl-N-methylcyclohexan-1-amine

CAS: 252854-34-5

Formula: C₉H₁₉N

Purity: 95%

Color and Shape: Liquid

Molecular weight: 141.2539

Ref: IN-DA019LXJ

4-Ethyl-N-Methylcyclohexan-1-Amine

CAS: 252854-34-5

4-Ethyl-N-Methylcyclohexan-1-Amine

Purity: 95%

Molecular weight: 141.25g/mol

Ref: 54-OR1027327

4-Ethyl-n-methylcyclohexan-1-amine

CAS: 252854-34-5

Purity: 95%

Molecular weight: 141.2579956

Ref: 10-F661516

4-Ethyl-N-methylcyclohexan-1-amine

CAS: 252854-34-5

4-Ethyl-N-methylcyclohexan-1-amine is a synthetic molecule that can be used as an intermediate in the synthesis of other chemical compounds. It is a high-throughput screening compound that has been shown to be effective in a number of experiments. 4EMC is oxidized by dehydrogenation to form 1,4-dimethylcyclohexane, which reacts with an acid chloride to form 4-(methylthio)cyclohexanecarboxylic acid. This synthesis pathway may be optimal for high throughput screening and analysis due to its simplicity and lack of chemistries.

Formula: C₉H₁₉N

Purity: Min. 95%

Molecular weight: 141.25 g/mol

Ref: 3D-CKA85434