CAS 25287-05-2
:2-(4-aminophenyl)-1H-benzo[de]isoquinoline-1,3(2H)-dione
Description:
2-(4-Aminophenyl)-1H-benzo[de]isoquinoline-1,3(2H)-dione, with the CAS number 25287-05-2, is a synthetic organic compound characterized by its complex structure, which includes a benzoisoquinoline core and an amino group. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in pharmaceuticals and organic electronics due to its unique electronic properties. The presence of the amino group suggests it may participate in hydrogen bonding and could be involved in various chemical reactions, including nucleophilic substitutions. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound may exhibit fluorescence, which can be advantageous in imaging applications. As with many organic compounds, its solubility can vary depending on the solvent used, and it may have specific stability considerations under different environmental conditions. Overall, 2-(4-aminophenyl)-1H-benzo[de]isoquinoline-1,3(2H)-dione represents a versatile compound with potential utility in various scientific fields.
Formula:C18H12N2O2
InChI:InChI=1/C18H12N2O2/c19-12-7-9-13(10-8-12)20-17(21)14-5-1-3-11-4-2-6-15(16(11)14)18(20)22/h1-10H,19H2
SMILES:c1cc2cccc3c2c(c1)c(=O)n(c1ccc(cc1)N)c3=O
Synonyms:- 1H-benz[de]isoquinoline-1,3(2H)-dione, 2-(4-aminophenyl)-
- 2-(4-Amino-phenyl)-benzo[de]isoquinoline-1,3-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.