CAS 252870-54-5

Galactaric acid, compd. with (2S,4E)-N-methyl-5-[5-(1-methylethoxy)-3-pyridinyl]-4-penten-2-amine (1:2)

Description:

Galactaric acid, also known as mucic acid, is a dicarboxylic acid derived from galactose, characterized by its two carboxyl functional groups. It typically appears as a white crystalline solid and is soluble in water, making it useful in various biochemical applications. The compound mentioned, which is a complex with a specific amine, indicates a potential for unique interactions due to the presence of the N-methyl-5-[5-(1-methylethoxy)-3-pyridinyl]-4-penten-2-amine moiety. This amine component suggests potential biological activity, possibly as a pharmaceutical agent or in drug design, due to the pyridine ring which is often associated with various biological functions. The combination of these two components may exhibit interesting properties, such as enhanced solubility, stability, or bioactivity compared to the individual components. Overall, the characteristics of this compound would be influenced by both the galactaric acid and the amine, making it a subject of interest in medicinal chemistry and related fields.

Formula: C₁₄H₂₂N₂OC₆H₁₀O₈

SMILES: C(=C/C[C@@H](NC)C)\C=1C=C(OC(C)C)C=NC1.[C@H]([C@H]([C@@H](C(O)=O)O)O)([C@H](C(O)=O)O)O

Synonyms:

• Galactaric acid, compd. with (2S,4E)-N-methyl-5-[5-(1-methylethoxy)-3-pyridinyl]-4-penten-2-amine (1:2)
• 4-Penten-2-amine, N-methyl-5-[5-(1-methylethoxy)-3-pyridinyl]-, (2S,4E)-, galactarate (2:1)

Ispronicline hemigalactarate

CAS: 252870-54-5

Ispronicline (AZD3480, TC 1734, RJR 1734) is an alpha4beta2 nicotinic receptor agonist for adult ADHD treatment.

Formula: C₁₄H₂₂N₂OC₆H₁₀O₈

Color and Shape: Solid

Molecular weight: 339.41

Ref: TM-T69595