CAS 252881-74-6

tert-butyl 3-{2-[2-(2-hydroxyethoxy)ethoxy]ethoxy}propanoate

Description:

Tert-butyl 3-{2-[2-(2-hydroxyethoxy)ethoxy]ethoxy}propanoate, with CAS number 252881-74-6, is an organic compound characterized by its ester functional group. It features a tert-butyl group, which contributes to its hydrophobic properties, and a propanoate moiety that enhances its reactivity in various chemical processes. The presence of multiple ethoxy units indicates that it has a significant degree of ether functionality, which can influence its solubility and interaction with other molecules. Additionally, the hydroxyethoxy group introduces a polar character, making the compound more soluble in polar solvents compared to non-polar ones. This compound is likely to exhibit moderate stability under standard conditions but may be sensitive to hydrolysis due to the ester bond. Its unique structure suggests potential applications in fields such as pharmaceuticals, where it may serve as a building block for more complex molecules or as a surfactant due to its amphiphilic nature. Overall, its properties make it a candidate for various chemical applications, particularly in organic synthesis and formulation chemistry.

Formula: C₁₃H₂₆O₆

InChI: InChI=1/C13H26O6/c1-13(2,3)19-12(15)4-6-16-8-10-18-11-9-17-7-5-14/h14H,4-11H2,1-3H3

SMILES: CC(C)(C)OC(=O)CCOCCOCCOCCO

Amino-PEG3-acid tert-Butyl Ester

CAS: 252881-74-6

Formula: C₁₃H₂₇NO₅

Purity: >90.0%(T)(HPLC)

Color and Shape: Colorless to Yellow clear liquid

Molecular weight: 277.36

Ref: 3B-B5586

Propanoic acid, 3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-, 1,1-dimethylethyl ester

CAS: 252881-74-6

Formula: C₁₃H₂₇NO₅

Purity: 97%

Color and Shape: Liquid

Molecular weight: 277.3572

Ref: IN-DA00365B

NH2-PEG3-C2-Boc

CAS: 252881-74-6

Amino-PEG3-t-butyl ester: a PEG derivative with an amino group and acid-labile t-butyl protected carboxyl.

Formula: C₁₃H₂₇NO₅

Color and Shape: Solid

Molecular weight: 277.36

Ref: TM-T20098

Amino- PEG3-t-butyl ester

CAS: 252881-74-6

Amino- PEG3-t-butyl ester

Formula: C₁₃H₂₇NO₅

Purity: By hplc: 98.5% (Typical Value in Batch COA)

Color and Shape: clear oil

Molecular weight: 277.36g/mol

Ref: 54-BIPG1072

NH2-PEG3-CH2CH2COOTBU

CAS: 252881-74-6

Formula: C₁₃H₂₇NO₅

Purity: 95%

Color and Shape: Liquid

Molecular weight: 277.361

Ref: 10-F533415