CAS 252881-74-6
:tert-butyl 3-{2-[2-(2-hydroxyethoxy)ethoxy]ethoxy}propanoate
Description:
Tert-butyl 3-{2-[2-(2-hydroxyethoxy)ethoxy]ethoxy}propanoate, with CAS number 252881-74-6, is an organic compound characterized by its ester functional group. It features a tert-butyl group, which contributes to its hydrophobic properties, and a propanoate moiety that enhances its reactivity in various chemical processes. The presence of multiple ethoxy units indicates that it has a significant degree of ether functionality, which can influence its solubility and interaction with other molecules. Additionally, the hydroxyethoxy group introduces a polar character, making the compound more soluble in polar solvents compared to non-polar ones. This compound is likely to exhibit moderate stability under standard conditions but may be sensitive to hydrolysis due to the ester bond. Its unique structure suggests potential applications in fields such as pharmaceuticals, where it may serve as a building block for more complex molecules or as a surfactant due to its amphiphilic nature. Overall, its properties make it a candidate for various chemical applications, particularly in organic synthesis and formulation chemistry.
Formula:C13H26O6
InChI:InChI=1/C13H26O6/c1-13(2,3)19-12(15)4-6-16-8-10-18-11-9-17-7-5-14/h14H,4-11H2,1-3H3
SMILES:CC(C)(C)OC(=O)CCOCCOCCOCCO
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Amino-PEG3-acid tert-Butyl Ester
CAS:Formula:C13H27NO5Purity:>90.0%(T)(HPLC)Color and Shape:Colorless to Yellow clear liquidMolecular weight:277.36Propanoic acid, 3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-, 1,1-dimethylethyl ester
CAS:Formula:C13H27NO5Purity:97%Color and Shape:LiquidMolecular weight:277.3572Ref: IN-DA00365B
1g44.00€5g103.00€1kgTo inquire25g289.00€50g675.00€100gTo inquire250gTo inquire100mg22.00€250mg29.00€NH2-PEG3-C2-Boc
CAS:Amino-PEG3-t-butyl ester: a PEG derivative with an amino group and acid-labile t-butyl protected carboxyl.Formula:C13H27NO5Color and Shape:SolidMolecular weight:277.36Amino- PEG3-t-butyl ester
CAS:Amino- PEG3-t-butyl esterFormula:C13H27NO5Purity:By hplc: 98.5% (Typical Value in Batch COA)Color and Shape: clear oilMolecular weight:277.36g/mol




